The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[(2-{2-[(2-{2-[2-(2-Acetylamino-3-cyclohexyl-propionylamino)-5-guanidino-pentanoylamino]-propionylamino}-4-methylsulfanyl-butyryl)-methyl-amino]-propionylamino}-3-hydroxy-propionyl)-methyl-amino]-4-methyl-pentanoic acid amide ID: ALA306004
PubChem CID: 10771929
Max Phase: Preclinical
Molecular Formula: C39H71N11O9S
Molecular Weight: 870.13
Molecule Type: Protein
Associated Items:
Names and Identifiers Canonical SMILES: CSCC[C@H](NC(=O)[C@H](C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CC1CCCCC1)NC(C)=O)C(=O)N(C)[C@@H](C)C(=O)N[C@@H](CO)C(=O)N(C)[C@@H](CC(C)C)C(N)=O
Standard InChI: InChI=1S/C39H71N11O9S/c1-22(2)19-31(32(40)53)50(7)38(59)30(21-51)48-34(55)24(4)49(6)37(58)28(16-18-60-8)47-33(54)23(3)44-35(56)27(15-12-17-43-39(41)42)46-36(57)29(45-25(5)52)20-26-13-10-9-11-14-26/h22-24,26-31,51H,9-21H2,1-8H3,(H2,40,53)(H,44,56)(H,45,52)(H,46,57)(H,47,54)(H,48,55)(H4,41,42,43)/t23-,24-,27-,28-,29-,30-,31-/m0/s1
Standard InChI Key: IDZZHAHYIVLOFG-AOHSAGBQSA-N
Molfile:
RDKit 2D
60 60 0 0 1 0 0 0 0 0999 V2000
10.2000 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0750 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7167 -1.1375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5917 -1.1375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6375 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6750 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1542 -0.8375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2417 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3792 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5042 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9500 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0292 -0.8375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9042 -0.8375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -1.1375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1167 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5542 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7625 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8625 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -3.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3417 -1.1375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9917 -0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1875 -1.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9917 -3.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2000 -0.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0750 -0.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6375 -1.7375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3792 -1.7375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5042 -1.7375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9500 -0.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2417 -0.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8625 -0.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7625 -1.7375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6042 -1.5625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -2.9417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9500 -3.8417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2792 -0.8375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5542 -1.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6750 -1.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7167 -1.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5917 -1.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0750 -2.6417 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2000 -2.0375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1167 -0.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7625 0.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1792 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0750 -2.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -1.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9917 -0.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9500 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5917 -2.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5875 0.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6000 0.5083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9500 -2.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2792 -0.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7625 0.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7542 1.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7417 1.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 1.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 15 1 0
5 7 1 0
6 1 1 0
7 6 1 0
8 3 1 0
9 13 1 0
10 12 1 0
11 14 1 0
12 16 1 0
13 22 1 0
14 21 1 0
15 5 1 0
16 2 1 0
17 8 1 0
18 9 1 0
19 35 2 0
20 18 1 0
21 10 1 0
22 11 1 0
23 20 1 0
24 19 1 0
25 1 2 0
26 2 2 0
27 5 2 0
28 9 2 0
29 10 2 0
30 11 2 0
8 31 1 1
18 32 1 1
33 17 2 0
34 23 2 0
35 51 1 0
36 19 1 0
37 17 1 0
16 38 1 6
6 39 1 6
40 3 1 0
41 4 1 0
42 48 1 0
43 32 1 0
44 39 1 0
15 45 1 1
46 31 1 0
47 23 1 0
48 38 1 0
22 49 1 6
21 50 1 1
51 55 1 0
52 42 1 0
53 43 1 0
54 43 1 0
55 49 1 0
56 46 1 0
57 46 1 0
58 54 1 0
59 53 1 0
60 58 1 0
60 59 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 870.13Molecular Weight (Monoisotopic): 869.5157AlogP: -1.58#Rotatable Bonds: 26Polar Surface Area: 313.84Molecular Species: BASEHBA: 11HBD: 9#RO5 Violations: 3HBA (Lipinski): 20HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.70CX Basic pKa: 10.81CX LogP: -2.59CX LogD: -4.69Aromatic Rings: ┄Heavy Atoms: 60QED Weighted: 0.03Np Likeness Score: 0.24
References 1. Bolin DR, Swain AL, Sarabu R, Berthel SJ, Gillespie P, Huby NJ, Makofske R, Orzechowski L, Perrotta A, Toth K, Cooper JP, Jiang N, Falcioni F, Campbell R, Cox D, Gaizband D, Belunis CJ, Vidovic D, Ito K, Crowther R, Kammlott U, Zhang X, Palermo R, Weber D, Guenot J, Nagy Z, Olson GL.. (2000) Peptide and peptide mimetic inhibitors of antigen presentation by HLA-DR class II MHC molecules. Design, structure-activity relationships, and X-ray crystal structures., 43 (11): [PMID:10841792 ] [10.1021/jm000034h ]