The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,3R)-3-Cyclopentylmethyl-N-hydroxy-4-oxo-4-piperidin-1-yl-2-(3,4,4-trimethyl-2,5-dioxo-imidazolidin-1-ylmethyl)-butyramide ID: ALA307192
PubChem CID: 193987
Max Phase: Preclinical
Molecular Formula: C22H36N4O5
Molecular Weight: 436.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Ro-32-3555 | CHEMBL307192|Ro-32-3555|(2S,3R)-3-Cyclopentylmethyl-N-hydroxy-4-oxo-4-piperidin-1-yl-2-(3,4,4-trimethyl-2,5-dioxo-imidazolidin-1-ylmethyl)-butyramide|SCHEMBL7297043|BDBM50290090|(2S,3R)-3-(cyclopentylmethyl)-N-hydroxy-4-oxo-4-piperidin-1-yl-2-[(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)methyl]butanamide|NS00121591|A815685|(2S,3R)-3-(cyclopentylmethyl)-4-oxo-4-(1-piperidyl)-2-[(3,4,4-trimethyl-2,5-dioxo-imidazolidin-1-yl)methyl]butanehydroxamic acid
Canonical SMILES: CN1C(=O)N(C[C@@H](C(=O)NO)[C@@H](CC2CCCC2)C(=O)N2CCCCC2)C(=O)C1(C)C
Standard InChI: InChI=1S/C22H36N4O5/c1-22(2)20(29)26(21(30)24(22)3)14-17(18(27)23-31)16(13-15-9-5-6-10-15)19(28)25-11-7-4-8-12-25/h15-17,31H,4-14H2,1-3H3,(H,23,27)/t16-,17-/m1/s1
Standard InChI Key: GFUITADOEPNRML-IAGOWNOFSA-N
Molfile:
RDKit 2D
31 33 0 0 1 0 0 0 0 0999 V2000
-1.9708 -0.7625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7875 -0.8417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6458 -1.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9625 -1.6417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2583 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2583 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5458 0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2583 -0.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8875 0.8875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3375 -0.2292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8375 -1.6917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5458 1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1667 -0.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 1.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6833 0.4750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.7208 -1.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1833 -2.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6750 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4833 0.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6000 0.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8792 1.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9583 2.4333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6208 3.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7875 2.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3125 0.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 2.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9708 3.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2458 3.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 1.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 1 0
5 3 1 0
6 9 1 1
7 6 1 0
8 7 1 0
9 1 1 0
10 8 1 0
11 6 1 0
12 2 2 0
13 3 2 0
7 14 1 1
15 8 2 0
16 11 2 0
17 11 1 0
18 4 1 0
19 5 1 0
20 5 1 0
21 17 1 0
22 10 1 0
23 10 1 0
24 14 1 0
25 24 1 0
26 24 1 0
27 22 1 0
28 23 1 0
29 26 1 0
30 25 1 0
31 28 1 0
4 5 1 0
29 30 1 0
31 27 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.55Molecular Weight (Monoisotopic): 436.2686AlogP: 1.99#Rotatable Bonds: 7Polar Surface Area: 110.26Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.85CX Basic pKa: 0.22CX LogP: 1.21CX LogD: 1.19Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: -0.28
References 1. Broadhurst M, Brown P, Lawton G, Ballantyne N, Borkakoti N, Bottomley K, Cooper M, Eatherton A, Kilford I, Malsher P, Nixon J, Lewis E, Sutton B, Johnson W. (1997) Design and synthesis of the cartilage protective agent (CPA, Ro32-3555), 7 (17): [10.1016/S0960-894X(97)00416-2 ]