2-Fluoro-N-{4-[(6-fluoro-1-pyridin-3-ylmethyl-1,2,3,4-tetrahydro-naphthalen-2-ylamino)-methyl]-cyclohexylmethyl}-benzenesulfonamide

ID: ALA3084885

Max Phase: Preclinical

Molecular Formula: C30H35F2N3O2S

Molecular Weight: 539.69

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(NC[C@H]1CC[C@H](CNC2CCc3cc(F)ccc3C2Cc2cccnc2)CC1)c1ccccc1F

Standard InChI:  InChI=1S/C30H35F2N3O2S/c31-25-12-13-26-24(17-25)11-14-29(27(26)16-23-4-3-15-33-18-23)34-19-21-7-9-22(10-8-21)20-35-38(36,37)30-6-2-1-5-28(30)32/h1-6,12-13,15,17-18,21-22,27,29,34-35H,7-11,14,16,19-20H2/t21-,22-,27?,29?

Standard InChI Key:  CMGJXHPGPMBSBU-DWPPAMOISA-N

Molfile:  

     RDKit          2D

 38 42  0  0  1  0  0  0  0  0999 V2000
   11.9476   -4.3410    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.9988   -5.1603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4163   -6.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1332   -6.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4163   -7.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1284   -4.3922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7669   -4.3011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8964   -3.5217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7108   -6.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8500   -6.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5611   -6.4517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7214   -5.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1332   -5.6211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7108   -8.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1445   -8.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7278   -3.9768    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8500   -7.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9939   -7.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4286   -3.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9939   -6.8613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5611   -5.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4325   -5.1033    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.4276   -5.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2828   -8.0789    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.3048   -5.6154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7117   -4.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2780   -5.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2780   -4.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7117   -5.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0119   -5.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9948   -3.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4276   -4.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9939   -4.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7839   -6.3380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7108   -5.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3673   -6.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9939   -5.2115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1070   -6.7988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4 10  1  0
  5 15  1  0
  6  1  1  0
  7  1  2  0
  8  1  2  0
  9  3  2  0
 10 11  1  0
 11 21  1  0
 12  2  1  0
 13  4  1  0
 14  5  2  0
 15 17  1  0
 16 32  1  0
 17 10  1  0
 18 14  1  0
 19  6  1  0
 20  9  1  0
 27 21  1  1
 22 12  1  0
 23 13  1  0
 24 18  1  0
 25  2  2  0
 26 19  1  6
 27 28  1  0
 28 31  1  0
 29 26  1  0
 30 29  1  0
 31 26  1  0
 32 23  2  0
 33 37  1  0
 34 12  2  0
 35 23  1  0
 36 25  1  0
 37 35  2  0
 38 36  2  0
 38 34  1  0
 30 27  1  0
  5  3  1  0
 18 20  2  0
 33 16  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3084885

    ---

Associated Targets(Human)

NPY5R Tchem Neuropeptide Y receptor type 5 (1834 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 539.69Molecular Weight (Monoisotopic): 539.2418AlogP: 5.38#Rotatable Bonds: 9
Polar Surface Area: 71.09Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.70CX Basic pKa: 10.82CX LogP: 4.69CX LogD: 3.42
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: -0.96

References

1. Youngman MA, McNally JJ, Lovenberg TW, Reitz AB, Willard NM, Nepomuceno DH, Wilson SJ, Crooke JJ, Rosenthal D, Vaidya AH, Dax SL..  (2000)  alpha-Substituted N-(sulfonamido)alkyl-beta-aminotetralins: potent and selective neuropeptide Y Y5 receptor antagonists.,  43  (3): [PMID:10669561] [10.1021/jm990468g]

Source