N-{4-[(6-Fluoro-1-pyridin-3-ylmethyl-1,2,3,4-tetrahydro-naphthalen-2-ylamino)-methyl]-cyclohexylmethyl}-benzenesulfonamide

ID: ALA3084886

Max Phase: Preclinical

Molecular Formula: C30H36FN3O2S

Molecular Weight: 521.70

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(NC[C@H]1CC[C@H](CNC2CCc3cc(F)ccc3C2Cc2cccnc2)CC1)c1ccccc1

Standard InChI:  InChI=1S/C30H36FN3O2S/c31-26-13-14-28-25(18-26)12-15-30(29(28)17-24-5-4-16-32-19-24)33-20-22-8-10-23(11-9-22)21-34-37(35,36)27-6-2-1-3-7-27/h1-7,13-14,16,18-19,22-23,29-30,33-34H,8-12,15,17,20-21H2/t22-,23-,29?,30?

Standard InChI Key:  QVZPBSHMFRXZBI-IMONQPJHSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  1  0  0  0  0  0999 V2000
    7.4148   -1.7896    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.8628   -4.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5798   -3.8998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8628   -5.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5929   -1.8421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2367   -1.7488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3623   -0.9677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1458   -3.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4673   -2.6115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2968   -4.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0138   -3.9056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5798   -3.0778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1458   -5.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5914   -5.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1633   -1.4224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2968   -5.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5712   -5.1414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8818   -1.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5712   -4.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0138   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8628   -2.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2766   -5.5436    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.7308   -2.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1648   -1.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4478   -1.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7308   -1.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1648   -2.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4652   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8628   -1.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5712   -1.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1901   -2.9729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7736   -3.0662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1458   -3.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5712   -2.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542   -3.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8261   -3.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5781   -4.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3 10  1  0
  4 14  1  0
  5  1  1  0
  6  1  2  0
  7  1  2  0
  8  2  2  0
  9  1  1  0
 10 11  1  0
 11 20  1  0
 12  3  1  0
 13  4  2  0
 14 16  1  0
 15 29  1  0
 16 10  1  0
 17 13  1  0
 18  5  1  0
 19  8  1  0
 23 20  1  1
 21 12  1  0
 22 17  1  0
 23 28  1  0
 24 18  1  6
 25 24  1  0
 26 25  1  0
 27 24  1  0
 28 27  1  0
 29 21  2  0
 30 34  1  0
 31  9  1  0
 32  9  2  0
 33 21  1  0
 34 33  2  0
 35 31  2  0
 36 32  1  0
 37 36  2  0
 37 35  1  0
 23 26  1  0
  4  2  1  0
 17 19  2  0
 30 15  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3084886

    ---

Associated Targets(Human)

NPY5R Tchem Neuropeptide Y receptor type 5 (1834 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.70Molecular Weight (Monoisotopic): 521.2512AlogP: 5.24#Rotatable Bonds: 9
Polar Surface Area: 71.09Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.09CX Basic pKa: 10.91CX LogP: 4.82CX LogD: 2.63
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.40Np Likeness Score: -0.81

References

1. Youngman MA, McNally JJ, Lovenberg TW, Reitz AB, Willard NM, Nepomuceno DH, Wilson SJ, Crooke JJ, Rosenthal D, Vaidya AH, Dax SL..  (2000)  alpha-Substituted N-(sulfonamido)alkyl-beta-aminotetralins: potent and selective neuropeptide Y Y5 receptor antagonists.,  43  (3): [PMID:10669561] [10.1021/jm990468g]

Source