The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-{4-[(1-Allyl-6-fluoro-1,2,3,4-tetrahydro-naphthalen-2-ylamino)-methyl]-cyclohexylmethyl}-benzenesulfonamide ID: ALA3084890
Max Phase: Preclinical
Molecular Formula: C27H35FN2O2S
Molecular Weight: 470.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CCC1c2ccc(F)cc2CCC1NC[C@H]1CC[C@H](CNS(=O)(=O)c2ccccc2)CC1
Standard InChI: InChI=1S/C27H35FN2O2S/c1-2-6-26-25-15-14-23(28)17-22(25)13-16-27(26)29-18-20-9-11-21(12-10-20)19-30-33(31,32)24-7-4-3-5-8-24/h2-5,7-8,14-15,17,20-21,26-27,29-30H,1,6,9-13,16,18-19H2/t20-,21-,26?,27?
Standard InChI Key: ZIYDLWAHMHYRTG-VNJSAXHHSA-N
Molfile:
RDKit 2D
33 36 0 0 1 0 0 0 0 0999 V2000
12.3038 -4.3563 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.7608 -6.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7608 -7.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4987 -4.4077 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4802 -6.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1259 -4.3220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2695 -3.5341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0586 -6.4802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3551 -5.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9018 -6.4802 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1996 -6.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0586 -8.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4973 -8.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1996 -7.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7779 -5.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7779 -4.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3392 -7.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7793 -3.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3392 -6.8913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9190 -5.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4802 -5.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6198 -8.1074 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.6383 -5.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0771 -4.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3577 -3.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6383 -4.4077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0771 -5.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3577 -5.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0916 -5.5381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6700 -5.6409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1602 -6.3603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7385 -6.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4750 -6.8228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 13 1 0
4 1 1 0
5 11 1 0
6 1 2 0
7 1 2 0
8 2 2 0
9 1 1 0
10 20 1 0
11 10 1 0
12 3 2 0
13 14 1 0
14 11 1 0
15 21 1 0
16 15 2 0
17 12 1 0
18 4 1 0
19 8 1 0
23 20 1 1
21 5 1 0
22 17 1 0
23 28 1 0
24 18 1 6
25 24 1 0
26 25 1 0
27 24 1 0
28 27 1 0
29 9 1 0
30 9 2 0
31 29 2 0
32 30 1 0
33 32 2 0
33 31 1 0
23 26 1 0
3 2 1 0
17 19 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.65Molecular Weight (Monoisotopic): 470.2403AlogP: 5.17#Rotatable Bonds: 9Polar Surface Area: 58.20Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.10CX Basic pKa: 10.95CX LogP: 5.03CX LogD: 2.84Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.65
References 1. Youngman MA, McNally JJ, Lovenberg TW, Reitz AB, Willard NM, Nepomuceno DH, Wilson SJ, Crooke JJ, Rosenthal D, Vaidya AH, Dax SL.. (2000) alpha-Substituted N-(sulfonamido)alkyl-beta-aminotetralins: potent and selective neuropeptide Y Y5 receptor antagonists., 43 (3): [PMID:10669561 ] [10.1021/jm990468g ]