N-{4-[(1-Allyl-6-fluoro-1,2,3,4-tetrahydro-naphthalen-2-ylamino)-methyl]-cyclohexylmethyl}-benzenesulfonamide

ID: ALA3084890

Max Phase: Preclinical

Molecular Formula: C27H35FN2O2S

Molecular Weight: 470.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CCC1c2ccc(F)cc2CCC1NC[C@H]1CC[C@H](CNS(=O)(=O)c2ccccc2)CC1

Standard InChI:  InChI=1S/C27H35FN2O2S/c1-2-6-26-25-15-14-23(28)17-22(25)13-16-27(26)29-18-20-9-11-21(12-10-20)19-30-33(31,32)24-7-4-3-5-8-24/h2-5,7-8,14-15,17,20-21,26-27,29-30H,1,6,9-13,16,18-19H2/t20-,21-,26?,27?

Standard InChI Key:  ZIYDLWAHMHYRTG-VNJSAXHHSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  1  0  0  0  0  0999 V2000
   12.3038   -4.3563    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.7608   -6.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7608   -7.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4987   -4.4077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4802   -6.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1259   -4.3220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2695   -3.5341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0586   -6.4802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3551   -5.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9018   -6.4802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1996   -6.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0586   -8.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4973   -8.1245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1996   -7.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7779   -5.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7779   -4.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3392   -7.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7793   -3.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3392   -6.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9190   -5.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4802   -5.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6198   -8.1074    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.6383   -5.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0771   -4.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3577   -3.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6383   -4.4077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0771   -5.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3577   -5.6580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0916   -5.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6700   -5.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1602   -6.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7385   -6.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4750   -6.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3 13  1  0
  4  1  1  0
  5 11  1  0
  6  1  2  0
  7  1  2  0
  8  2  2  0
  9  1  1  0
 10 20  1  0
 11 10  1  0
 12  3  2  0
 13 14  1  0
 14 11  1  0
 15 21  1  0
 16 15  2  0
 17 12  1  0
 18  4  1  0
 19  8  1  0
 23 20  1  1
 21  5  1  0
 22 17  1  0
 23 28  1  0
 24 18  1  6
 25 24  1  0
 26 25  1  0
 27 24  1  0
 28 27  1  0
 29  9  1  0
 30  9  2  0
 31 29  2  0
 32 30  1  0
 33 32  2  0
 33 31  1  0
 23 26  1  0
  3  2  1  0
 17 19  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3084890

    ---

Associated Targets(Human)

NPY5R Tchem Neuropeptide Y receptor type 5 (1834 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.65Molecular Weight (Monoisotopic): 470.2403AlogP: 5.17#Rotatable Bonds: 9
Polar Surface Area: 58.20Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.10CX Basic pKa: 10.95CX LogP: 5.03CX LogD: 2.84
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: -0.65

References

1. Youngman MA, McNally JJ, Lovenberg TW, Reitz AB, Willard NM, Nepomuceno DH, Wilson SJ, Crooke JJ, Rosenthal D, Vaidya AH, Dax SL..  (2000)  alpha-Substituted N-(sulfonamido)alkyl-beta-aminotetralins: potent and selective neuropeptide Y Y5 receptor antagonists.,  43  (3): [PMID:10669561] [10.1021/jm990468g]

Source