N-{4-[(6-Methoxy-1-pyridin-3-ylmethyl-1,2,3,4-tetrahydro-naphthalen-2-ylamino)-methyl]-cyclohexylmethyl}-benzenesulfonamide

ID: ALA3084895

Max Phase: Preclinical

Molecular Formula: C31H39N3O3S

Molecular Weight: 533.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)CCC(NC[C@H]1CC[C@H](CNS(=O)(=O)c3ccccc3)CC1)C2Cc1cccnc1

Standard InChI:  InChI=1S/C31H39N3O3S/c1-37-27-14-15-29-26(19-27)13-16-31(30(29)18-25-6-5-17-32-20-25)33-21-23-9-11-24(12-10-23)22-34-38(35,36)28-7-3-2-4-8-28/h2-8,14-15,17,19-20,23-24,30-31,33-34H,9-13,16,18,21-22H2,1H3/t23-,24-,30?,31?

Standard InChI Key:  OMXFBWUCMLOHPQ-HPELYDOMSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  1  0  0  0  0  0999 V2000
   12.1742   -1.8181    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.6268   -4.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3402   -3.9353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6268   -5.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3571   -1.8699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0026   -1.7778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1224   -1.0011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9077   -3.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2259   -2.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0652   -4.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7728   -3.9411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3402   -3.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9077   -5.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3517   -5.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9249   -1.4556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0652   -5.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1942   -5.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6553   -1.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1942   -4.3495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7728   -3.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6326   -2.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9303   -1.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4978   -2.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2341   -3.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2169   -1.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4978   -1.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9303   -2.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4751   -5.5635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.6326   -1.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1942   -1.8641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9623   -3.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5355   -3.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9077   -3.1126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4578   -6.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1942   -2.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5988   -3.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0199   -3.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3468   -4.2863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3 10  1  0
  4 14  1  0
  5  1  1  0
  6  1  2  0
  7  1  2  0
  8  2  2  0
  9  1  1  0
 10 11  1  0
 11 20  1  0
 12  3  1  0
 13  4  2  0
 14 16  1  0
 15 29  1  0
 16 10  1  0
 17 13  1  0
 18  5  1  0
 19  8  1  0
 23 20  1  1
 21 12  1  0
 22 18  1  6
 23 24  1  0
 24 27  1  0
 25 22  1  0
 26 25  1  0
 27 22  1  0
 28 17  1  0
 29 21  2  0
 30 35  1  0
 31  9  1  0
 32  9  2  0
 33 21  1  0
 34 28  1  0
 35 33  2  0
 36 32  1  0
 37 31  2  0
 38 36  2  0
 38 37  1  0
 23 26  1  0
  4  2  1  0
 17 19  2  0
 30 15  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3084895

    ---

Associated Targets(Human)

NPY5R Tchem Neuropeptide Y receptor type 5 (1834 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.74Molecular Weight (Monoisotopic): 533.2712AlogP: 5.11#Rotatable Bonds: 10
Polar Surface Area: 80.32Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.10CX Basic pKa: 10.93CX LogP: 4.51CX LogD: 2.32
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.38Np Likeness Score: -0.54

References

1. Youngman MA, McNally JJ, Lovenberg TW, Reitz AB, Willard NM, Nepomuceno DH, Wilson SJ, Crooke JJ, Rosenthal D, Vaidya AH, Dax SL..  (2000)  alpha-Substituted N-(sulfonamido)alkyl-beta-aminotetralins: potent and selective neuropeptide Y Y5 receptor antagonists.,  43  (3): [PMID:10669561] [10.1021/jm990468g]

Source