4-[(2-Fluoro-benzenesulfonylamino)-methyl]-cyclohexanecarboxylic acid (6-fluoro-1-pyridin-3-ylmethyl-1,2,3,4-tetrahydro-naphthalen-2-yl)-amide

ID: ALA3084904

Max Phase: Preclinical

Molecular Formula: C30H33F2N3O3S

Molecular Weight: 553.68

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  O=C(NC1CCc2cc(F)ccc2C1Cc1cccnc1)[C@H]1CC[C@H](CNS(=O)(=O)c2ccccc2F)CC1

Standard InChI:  InChI=1S/C30H33F2N3O3S/c31-24-12-13-25-23(17-24)11-14-28(26(25)16-21-4-3-15-33-18-21)35-30(36)22-9-7-20(8-10-22)19-34-39(37,38)29-6-2-1-5-27(29)32/h1-6,12-13,15,17-18,20,22,26,28,34H,7-11,14,16,19H2,(H,35,36)/t20-,22-,26?,28?

Standard InChI Key:  YSNXGFNZCPGGMB-KBFVXFJFSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  1  0  0  0  0  0999 V2000
   10.0510   -1.1996    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.1022   -2.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2524   -3.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5361   -3.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6679   -2.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6679   -3.3086    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9687   -3.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5361   -4.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2324   -1.2507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9998   -0.3809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8696   -1.1597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8198   -3.3086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8355   -2.3763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3842   -2.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2524   -2.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8198   -4.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9687   -2.0807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2524   -4.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9687   -4.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8368   -0.8357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3842   -1.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1176   -2.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1035   -4.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5331   -0.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1035   -3.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5348   -1.9613    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5361   -2.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4042   -4.9346    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.1005   -0.8357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8168   -2.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4200   -2.4729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8168   -1.2507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5361   -1.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1035   -1.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8867   -3.1950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8198   -2.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4711   -3.2916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1035   -2.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2215   -3.6555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  7  1  0
  4  3  1  0
 14  5  1  1
  6  5  1  0
  7  6  1  0
  8 18  1  0
  9  1  1  0
 10  1  2  0
 11  1  2  0
 12  4  2  0
 13  2  1  0
 14 22  1  0
 15  3  1  0
 16  8  2  0
 17  5  2  0
 18 19  1  0
 19  7  1  0
 20 33  1  0
 21 29  1  0
 22 30  1  0
 23 16  1  0
 24  9  1  0
 25 12  1  0
 26 13  1  0
 27 15  1  0
 28 23  1  0
 29 32  1  0
 30 32  1  0
 31  2  2  0
 32 24  1  6
 33 27  2  0
 34 38  1  0
 35 13  2  0
 36 27  1  0
 37 31  1  0
 38 36  2  0
 39 37  2  0
 39 35  1  0
 14 21  1  0
  8  4  1  0
 23 25  2  0
 34 20  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA3084904

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 553.68

Molecular Weight (Monoisotopic): 553.2211

AlogP: 4.90

#Rotatable Bonds: 8

Polar Surface Area: 88.16

Molecular Species: NEUTRAL

HBA: 4

HBD: 2

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 8.70

CX Basic pKa: 4.93

CX LogP: 5.13

CX LogD: 5.11

Aromatic Rings: 3

Heavy Atoms: 39

QED Weighted: 0.42

Np Likeness Score: -1.17

References

1. Youngman MA, McNally JJ, Lovenberg TW, Reitz AB, Willard NM, Nepomuceno DH, Wilson SJ, Crooke JJ, Rosenthal D, Vaidya AH, Dax SL..  (2000)  alpha-Substituted N-(sulfonamido)alkyl-beta-aminotetralins: potent and selective neuropeptide Y Y5 receptor antagonists.,  43  (3): [PMID:10669561] [10.1021/jm990468g]

Source

Source(1):

• Scientific Literature