4-{2-[3-(4-Amino-cyclohexylamino)-5-chloro-6-methyl-2-oxo-2H-pyrazin-1-yl]-acetylamino}-benzamide TFA

ID: ALA3085007

PubChem CID: 44394597

Max Phase: Preclinical

Molecular Formula: C22H26ClF3N6O5

Molecular Weight: 432.91

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(Cl)nc(N[C@H]2CC[C@H](N)CC2)c(=O)n1CC(=O)Nc1ccc(C(N)=O)cc1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C20H25ClN6O3.C2HF3O2/c1-11-17(21)26-19(25-15-8-4-13(22)5-9-15)20(30)27(11)10-16(28)24-14-6-2-12(3-7-14)18(23)29;3-2(4,5)1(6)7/h2-3,6-7,13,15H,4-5,8-10,22H2,1H3,(H2,23,29)(H,24,28)(H,25,26);(H,6,7)/t13-,15-;

Standard InChI Key:  WHDXCQNRGXFBBC-IOJSEOPQSA-N

Molfile:  

     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   -2.6254    2.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6254    3.3358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3358    3.7595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9649    1.9691    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6254    1.7572    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2984    1.9691    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9150    3.7595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3033   -1.1133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1299   -0.2991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1299   -1.1133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4195   -1.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4195    0.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3033   -0.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8403   -1.5329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0136   -1.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7240   -1.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2758    0.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4344   -1.5204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4195   -2.3471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5779   -0.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4195    0.9471    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.2260    0.9471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7240   -0.2866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8551    0.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5779   -1.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0236   -0.2368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1447   -1.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5506   -1.1133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0136    0.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1447   -0.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8676   -1.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6817    0.1204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9713   -0.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2610   -1.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5506   -0.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2485    0.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9713   -1.1092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  1  1  0
  5  1  1  0
  6  1  1  0
  7  2  1  0
  9 12  1  0
 10 11  1  0
 11  8  1  0
 12 13  2  0
 13  8  1  0
 14 10  1  0
 15  8  1  0
 16 15  1  0
 17 20  1  0
 18 16  1  0
 19 11  2  0
 20 24  1  0
 21 12  1  0
 22 17  2  0
 23 16  2  0
 24 30  2  0
 25 31  1  0
 26 17  1  0
 27 18  1  0
 28 14  1  6
 29 13  1  0
 30 27  1  0
 31 27  2  0
 33 32  1  1
 33 37  1  0
 34 28  1  0
 35 28  1  0
 36 35  1  0
 37 34  1  0
 10  9  2  0
 36 33  1  0
 25 20  2  0
M  END

Associated Targets(Human)

TPSAB1 Tclin Tryptase beta-1 (295 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.91Molecular Weight (Monoisotopic): 432.1677AlogP: 1.62#Rotatable Bonds: 6
Polar Surface Area: 145.13Molecular Species: BASEHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.19CX Basic pKa: 10.15CX LogP: 0.27CX LogD: -2.30
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: -1.55

References

1. Hopkins C, Neuenschwander K, Scotese A, Jackson S, Nieduzak T, Pauls H, Liang G, Sides K, Cramer D, Cairns J, Maignan S, Mathieu M..  (2004)  Novel pyrazinone inhibitors of mast cell tryptase: synthesis and SAR evaluation.,  14  (19): [PMID:15341931] [10.1016/j.bmcl.2004.07.051]

Source