The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-{2-[3-(4-Amino-cyclohexylamino)-5-chloro-6-methyl-2-oxo-2H-pyrazin-1-yl]-acetylamino}-benzamide TFA ID: ALA3085008
PubChem CID: 44394647
Max Phase: Preclinical
Molecular Formula: C22H26ClF3N6O5
Molecular Weight: 432.91
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(Cl)nc(N[C@H]2CC[C@H](N)CC2)c(=O)n1CC(=O)Nc1cccc(C(N)=O)c1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C20H25ClN6O3.C2HF3O2/c1-11-17(21)26-19(25-14-7-5-13(22)6-8-14)20(30)27(11)10-16(28)24-15-4-2-3-12(9-15)18(23)29;3-2(4,5)1(6)7/h2-4,9,13-14H,5-8,10,22H2,1H3,(H2,23,29)(H,24,28)(H,25,26);(H,6,7)/t13-,14-;
Standard InChI Key: QNSDRDCVOJDKNW-SKKCDYJJSA-N
Molfile:
RDKit 2D
37 38 0 0 0 0 0 0 0 0999 V2000
-2.4929 2.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4929 3.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2087 3.6790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1671 1.8978 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.8311 1.8978 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.4929 1.6813 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7812 3.6790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4370 -1.1986 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9946 -0.3746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9946 -1.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2830 -1.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2830 0.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4370 -0.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7063 -1.6106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1528 -1.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8645 -1.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9953 0.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9995 0.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5762 -1.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2830 -2.4346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2878 -0.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2878 -1.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2830 0.8698 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2753 1.2818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8645 -0.3621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7112 1.2818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4180 -1.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1528 0.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5529 0.0457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8413 -0.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1296 -1.6106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4180 -0.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1171 0.0457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8413 -1.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7194 -0.3621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7194 -1.1903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0120 -1.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 1 1 0
6 1 1 0
7 2 1 0
9 12 1 0
10 11 1 0
11 8 1 0
12 13 2 0
13 8 1 0
14 10 1 0
15 8 1 0
16 15 1 0
17 18 1 0
18 21 2 0
19 16 1 0
20 11 2 0
21 22 1 0
22 19 1 0
23 12 1 0
24 17 2 0
25 16 2 0
26 17 1 0
27 14 1 6
28 13 1 0
30 29 1 1
30 34 1 0
31 27 1 0
32 27 1 0
33 32 1 0
34 31 1 0
35 36 2 0
36 37 1 0
37 22 2 0
10 9 2 0
33 30 1 0
18 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.91Molecular Weight (Monoisotopic): 432.1677AlogP: 1.62#Rotatable Bonds: 6Polar Surface Area: 145.13Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.22CX Basic pKa: 10.15CX LogP: 0.27CX LogD: -2.30Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.55Np Likeness Score: -1.64
References 1. Hopkins C, Neuenschwander K, Scotese A, Jackson S, Nieduzak T, Pauls H, Liang G, Sides K, Cramer D, Cairns J, Maignan S, Mathieu M.. (2004) Novel pyrazinone inhibitors of mast cell tryptase: synthesis and SAR evaluation., 14 (19): [PMID:15341931 ] [10.1016/j.bmcl.2004.07.051 ]