The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[3-(4-Amino-cyclohexylamino)-5-chloro-6-methyl-2-oxo-2H-pyrazin-1-yl]-N-(4-aminomethyl-phenyl)-acetamide TFA ID: ALA3085014
PubChem CID: 44394815
Max Phase: Preclinical
Molecular Formula: C22H28ClF3N6O4
Molecular Weight: 418.93
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(Cl)nc(N[C@H]2CC[C@H](N)CC2)c(=O)n1CC(=O)Nc1ccc(CN)cc1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C20H27ClN6O2.C2HF3O2/c1-12-18(21)26-19(25-16-8-4-14(23)5-9-16)20(29)27(12)11-17(28)24-15-6-2-13(10-22)3-7-15;3-2(4,5)1(6)7/h2-3,6-7,14,16H,4-5,8-11,22-23H2,1H3,(H,24,28)(H,25,26);(H,6,7)/t14-,16-;
Standard InChI Key: OIGVPHBTJXCWTC-SWQINVOKSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
-2.4833 2.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4833 3.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2000 3.7958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8208 2.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.4833 1.7875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.1583 2.0000 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.7708 3.7958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4500 -1.0917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9833 -0.2667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9833 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2708 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2708 0.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4500 -0.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6958 -1.5042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1667 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5917 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2708 -2.3292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2708 0.9750 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.8792 -0.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4083 -1.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1625 0.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5458 0.1500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -0.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8333 -0.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0250 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3042 -0.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1875 -0.2125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0167 0.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7375 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1208 -1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4083 -0.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1125 0.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8333 -1.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4417 0.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 1 1 0
5 1 1 0
6 1 1 0
7 2 1 0
9 12 1 0
10 11 1 0
11 8 1 0
12 13 2 0
13 8 1 0
14 10 1 0
15 8 1 0
16 15 1 0
17 16 1 0
18 11 2 0
19 12 1 0
20 16 2 0
21 17 1 0
22 14 1 6
23 13 1 0
26 24 1 1
25 31 2 0
26 35 1 0
27 21 2 0
28 21 1 0
29 36 1 0
30 28 2 0
31 27 1 0
32 22 1 0
33 22 1 0
34 33 1 0
35 32 1 0
36 25 1 0
10 9 2 0
34 26 1 0
30 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.93Molecular Weight (Monoisotopic): 418.1884AlogP: 1.98#Rotatable Bonds: 6Polar Surface Area: 128.06Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.25CX Basic pKa: 10.20CX LogP: 0.54CX LogD: -3.86Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.57Np Likeness Score: -1.38
References 1. Hopkins C, Neuenschwander K, Scotese A, Jackson S, Nieduzak T, Pauls H, Liang G, Sides K, Cramer D, Cairns J, Maignan S, Mathieu M.. (2004) Novel pyrazinone inhibitors of mast cell tryptase: synthesis and SAR evaluation., 14 (19): [PMID:15341931 ] [10.1016/j.bmcl.2004.07.051 ]