(S)-2-[(R)-2-({5-[(S)-1-((R)-1-Carboxy-ethylcarbamoyl)-ethylcarbamoyl]-9,9-dimethyl-9H-xanthene-4-carbonyl}-amino)-propionylamino]-propionic acid

ID: ALA3085151

PubChem CID: 76316972

Max Phase: Preclinical

Molecular Formula: C29H34N4O9

Molecular Weight: 582.61

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@H](NC(=O)[C@H](C)NC(=O)c1cccc2c1Oc1c(C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)O)cccc1C2(C)C)C(=O)O

Standard InChI:  InChI=1S/C29H34N4O9/c1-13(23(34)32-15(3)27(38)39)30-25(36)17-9-7-11-19-21(17)42-22-18(10-8-12-20(22)29(19,5)6)26(37)31-14(2)24(35)33-16(4)28(40)41/h7-16H,1-6H3,(H,30,36)(H,31,37)(H,32,34)(H,33,35)(H,38,39)(H,40,41)/t13-,14-,15-,16-/m0/s1

Standard InChI Key:  QHRORTXZHJRITC-VGWMRTNUSA-N

Molfile:  

     RDKit          2D

 42 44  0  0  0  0  0  0  0  0999 V2000
   -0.9845    0.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4667    0.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2561   -0.2390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7016   -0.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1838   -0.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2674    1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7016   -1.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1838   -1.0472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9845    1.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4667    1.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6179   -2.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1528   -2.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4357   -1.4570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9009   -1.4570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6350   -3.4887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1699   -3.5057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3634   -4.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8927   -4.7179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4357   -2.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9179   -2.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8869   -3.8984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3521   -3.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0016   -1.4740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4780   -1.4683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3293   -2.2423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8585   -2.2594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1869   -5.1448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6634   -5.1277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4073    0.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9009    0.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0692   -5.0935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6211   -5.1220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8479    2.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3131    2.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7016    1.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1780    1.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9009    1.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4073    1.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2179   -2.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7357   -2.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0521   -3.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5869   -3.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  4  1  2  0
  5  2  1  0
  6  9  1  0
  7  4  1  0
  8  5  1  0
  9  1  1  0
 10  6  1  0
 11 20  1  0
 12 19  1  0
 13  7  1  0
 14  8  1  0
 15 11  1  0
 16 12  1  0
 17 22  1  0
 18 21  1  0
 19 13  1  0
 20 14  1  0
 21 16  1  0
 22 15  1  0
 23  7  2  0
 24  8  2  0
 25 11  2  0
 26 12  2  0
 27 18  2  0
 28 17  2  0
 29  4  1  0
 30  5  2  0
 31 17  1  0
 32 18  1  0
 33  6  1  0
 34  6  1  0
 35  9  2  0
 36 10  1  0
 37 36  2  0
 38 35  1  0
 20 39  1  6
 19 40  1  1
 22 41  1  1
 21 42  1  6
 29 38  2  0
 10  2  2  0
 37 30  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3085151

   (S)-2-[(R)-2-({5-[(S)-1-((R)-1-Carboxy-ethylcarbamoyl)-ethylcarbamoyl]-9,9-dimethyl-9H-xanthene-4-carbonyl}-amino)-propionylamino]-propionic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 582.61

Molecular Weight (Monoisotopic): 582.2326

AlogP: 1.53

#Rotatable Bonds: 10

Polar Surface Area: 200.23

Molecular Species: ACID

HBA: 7

HBD: 6

#RO5 Violations: 2

HBA (Lipinski): 13

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 2.91

CX Basic pKa: ┄

CX LogP: 1.35

CX LogD: -5.54

Aromatic Rings: 2

Heavy Atoms: 42

QED Weighted: 0.24

Np Likeness Score: -0.02

References

1. Pryor KE, La Clair JJ..  (1999)  A rapid method to identify exo-protease inhibitors.,  9  (16): [PMID:10476856] [10.1016/s0960-894x(99)00387-x]

Source

Source(1):

• Scientific Literature