The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-[(R)-2-({5-[(S)-1-((R)-1-Carboxy-ethylcarbamoyl)-ethylcarbamoyl]-9,9-dimethyl-9H-xanthene-4-carbonyl}-amino)-propionylamino]-propionic acid ID: ALA3085151
PubChem CID: 76316972
Max Phase: Preclinical
Molecular Formula: C29H34N4O9
Molecular Weight: 582.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](NC(=O)[C@H](C)NC(=O)c1cccc2c1Oc1c(C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)O)cccc1C2(C)C)C(=O)O
Standard InChI: InChI=1S/C29H34N4O9/c1-13(23(34)32-15(3)27(38)39)30-25(36)17-9-7-11-19-21(17)42-22-18(10-8-12-20(22)29(19,5)6)26(37)31-14(2)24(35)33-16(4)28(40)41/h7-16H,1-6H3,(H,30,36)(H,31,37)(H,32,34)(H,33,35)(H,38,39)(H,40,41)/t13-,14-,15-,16-/m0/s1
Standard InChI Key: QHRORTXZHJRITC-VGWMRTNUSA-N
Molfile:
RDKit 2D
42 44 0 0 0 0 0 0 0 0999 V2000
-0.9845 0.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4667 0.1878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2561 -0.2390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7016 -0.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1838 -0.2277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2674 1.4284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7016 -1.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1838 -1.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9845 1.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4667 1.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6179 -2.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1528 -2.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4357 -1.4570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9009 -1.4570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6350 -3.4887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1699 -3.5057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3634 -4.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8927 -4.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4357 -2.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9179 -2.2765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8869 -3.8984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3521 -3.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0016 -1.4740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4780 -1.4683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3293 -2.2423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8585 -2.2594 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1869 -5.1448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6634 -5.1277 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4073 0.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9009 0.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0692 -5.0935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6211 -5.1220 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8479 2.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3131 2.0146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7016 1.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1780 1.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9009 1.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4073 1.0073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2179 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7357 -2.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0521 -3.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5869 -3.4829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 1 0
4 1 2 0
5 2 1 0
6 9 1 0
7 4 1 0
8 5 1 0
9 1 1 0
10 6 1 0
11 20 1 0
12 19 1 0
13 7 1 0
14 8 1 0
15 11 1 0
16 12 1 0
17 22 1 0
18 21 1 0
19 13 1 0
20 14 1 0
21 16 1 0
22 15 1 0
23 7 2 0
24 8 2 0
25 11 2 0
26 12 2 0
27 18 2 0
28 17 2 0
29 4 1 0
30 5 2 0
31 17 1 0
32 18 1 0
33 6 1 0
34 6 1 0
35 9 2 0
36 10 1 0
37 36 2 0
38 35 1 0
20 39 1 6
19 40 1 1
22 41 1 1
21 42 1 6
29 38 2 0
10 2 2 0
37 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 582.61Molecular Weight (Monoisotopic): 582.2326AlogP: 1.53#Rotatable Bonds: 10Polar Surface Area: 200.23Molecular Species: ACIDHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 2.91CX Basic pKa: ┄CX LogP: 1.35CX LogD: -5.54Aromatic Rings: 2Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -0.02