(R)-2-{[5-((S)-1-Carboxy-2-methyl-propylcarbamoyl)-9,9-dimethyl-9H-xanthene-4-carbonyl]-amino}-3-methyl-butyric acid

ID: ALA3085152

PubChem CID: 76324337

Max Phase: Preclinical

Molecular Formula: C27H32N2O7

Molecular Weight: 496.56

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(C)[C@H](NC(=O)c1cccc2c1Oc1c(C(=O)N[C@H](C(=O)O)C(C)C)cccc1C2(C)C)C(=O)O

Standard InChI:  InChI=1S/C27H32N2O7/c1-13(2)19(25(32)33)28-23(30)15-9-7-11-17-21(15)36-22-16(10-8-12-18(22)27(17,5)6)24(31)29-20(14(3)4)26(34)35/h7-14,19-20H,1-6H3,(H,28,30)(H,29,31)(H,32,33)(H,34,35)/t19-,20-/m0/s1

Standard InChI Key:  AJCCNSPYQOYLQT-PMACEKPBSA-N

Molfile:  

     RDKit          2D

 36 38  0  0  0  0  0  0  0  0999 V2000
   -0.9845    0.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4667    0.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2561   -0.2390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7016   -0.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1838   -0.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2674    1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7016   -1.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1838   -1.0472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9845    1.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4667    1.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9009   -1.4570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4357   -1.4570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9179   -2.2765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4357   -2.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6179   -2.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1528   -2.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0016   -1.4740    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4780   -1.4683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8585   -2.2594    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3293   -2.2423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7357   -2.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2179   -2.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6350   -3.4887    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1699   -3.5057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4073    0.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9009    0.1991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8479    2.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3131    2.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7016    1.4171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1780    1.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9009    1.0244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4073    1.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7415   -3.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0187   -2.3049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5009   -2.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2350   -3.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  1  1  0
  4  1  2  0
  5  2  1  0
  6  9  1  0
  7  4  1  0
  8  5  1  0
  9  1  1  0
 10  6  1  0
 11  8  1  0
 12  7  1  0
 13 11  1  0
 14 12  1  0
 15 13  1  0
 16 14  1  0
 17  7  2  0
 18  8  2  0
 19 16  2  0
 20 15  2  0
 14 21  1  1
 13 22  1  6
 23 15  1  0
 24 16  1  0
 25  4  1  0
 26  5  2  0
 27  6  1  0
 28  6  1  0
 29  9  2  0
 30 10  1  0
 31 30  2  0
 32 29  1  0
 33 21  1  0
 34 21  1  0
 35 22  1  0
 36 22  1  0
 25 32  2  0
 10  2  2  0
 31 26  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3085152

   (R)-2-{[5-((S)-1-Carboxy-2-methyl-propylcarbamoyl)-9,9-dimethyl-9H-xanthene-4-carbonyl]-amino}-3-methyl-butyric acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 496.56

Molecular Weight (Monoisotopic): 496.2210

AlogP: 3.80

#Rotatable Bonds: 8

Polar Surface Area: 142.03

Molecular Species: ACID

HBA: 5

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 9

HBD (Lipinski): 4

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 3.01

CX Basic pKa: ┄

CX LogP: 4.20

CX LogD: -2.65

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.44

Np Likeness Score: 0.01

References

1. Pryor KE, La Clair JJ..  (1999)  A rapid method to identify exo-protease inhibitors.,  9  (16): [PMID:10476856] [10.1016/s0960-894x(99)00387-x]

Source

Source(1):

• Scientific Literature