The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2-Amino-6-benzyloxy-purin-9-yl)-acetic acid 10,13-dimethyl-3-oxo-hexadecahydro-cyclopenta[a]phenanthren-17-yl ester ID: ALA3085510
PubChem CID: 9985499
Max Phase: Preclinical
Molecular Formula: C33H41N5O4
Molecular Weight: 571.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@H]3[C@@H](CCC4CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2OC(=O)Cn1cnc2c(OCc3ccccc3)nc(N)nc21
Standard InChI: InChI=1S/C33H41N5O4/c1-32-14-12-22(39)16-21(32)8-9-23-24-10-11-26(33(24,2)15-13-25(23)32)42-27(40)17-38-19-35-28-29(38)36-31(34)37-30(28)41-18-20-6-4-3-5-7-20/h3-7,19,21,23-26H,8-18H2,1-2H3,(H2,34,36,37)/t21?,23-,24-,25-,26-,32-,33-/m0/s1
Standard InChI Key: YEPBDNAWSZLNIO-HFOWXWJZSA-N
Molfile:
RDKit 2D
45 51 0 0 0 0 0 0 0 0999 V2000
5.8542 -9.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8625 -8.6625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6417 -9.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -9.9042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6500 -8.4042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4292 -8.6625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -8.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6167 -12.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -13.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4292 -9.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 -13.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6125 -13.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1375 -9.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8917 -13.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4042 -12.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -14.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7042 -10.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9125 -11.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9000 -10.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1875 -12.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9542 -11.4917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -13.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3917 -13.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8917 -14.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1417 -7.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -14.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 -14.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8792 -12.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0500 -14.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2542 -10.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7125 -9.9042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3292 -14.8042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0500 -13.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8625 -7.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4667 -12.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6167 -11.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8625 -6.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1500 -5.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5792 -5.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5792 -4.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1500 -4.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8667 -4.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8917 -12.7542 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.6892 -13.9964 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.1792 -13.9792 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 1 1 0
5 2 1 0
6 10 1 0
7 2 1 0
8 15 1 0
9 11 1 0
10 4 2 0
11 20 1 0
12 8 1 0
13 3 1 0
14 12 1 0
15 21 1 1
16 9 1 0
17 19 1 0
18 8 1 0
19 3 1 0
20 18 1 0
21 17 1 0
22 9 1 0
23 28 1 0
24 14 1 0
25 7 1 0
26 16 1 0
27 24 1 0
28 15 1 0
29 33 1 0
30 17 2 0
31 10 1 0
32 29 2 0
33 22 1 0
34 25 1 0
9 35 1 1
8 36 1 1
37 34 1 0
38 37 1 0
39 37 2 0
40 39 1 0
41 38 2 0
42 40 2 0
13 5 2 0
7 6 2 0
12 23 1 0
14 11 1 0
41 42 1 0
16 27 1 0
26 29 1 0
14 43 1 1
12 44 1 6
11 45 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 571.72Molecular Weight (Monoisotopic): 571.3159AlogP: 5.51#Rotatable Bonds: 6Polar Surface Area: 122.22Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.54CX LogP: 5.49CX LogD: 5.49Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.38Np Likeness Score: 0.66
References 1. Chae MY, McDougall MG, Dolan ME, Swenn K, Pegg AE, Moschel RC.. (1994) Substituted O6-benzylguanine derivatives and their inactivation of human O6-alkylguanine-DNA alkyltransferase., 37 (3): [PMID:8308861 ] [10.1021/jm00029a005 ]