(1S,9aR,11aS)-9a,11a-Dimethyl-7-oxo-2,3,3a,3b,4,5,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[i]phenanthridine-1-carboxylic acid adamantan-2-yl ester

ID: ALA3085538

Max Phase: Preclinical

Molecular Formula: C29H41NO3

Molecular Weight: 451.65

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H]3[C@@H](CNC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)OC1[C@H]2C[C@@H]3C[C@@H](C[C@H]1C3)C2

Standard InChI:  InChI=1S/C29H41NO3/c1-28-8-6-23-21(15-30-25-14-20(31)5-7-29(23,25)2)22(28)3-4-24(28)27(32)33-26-18-10-16-9-17(12-18)13-19(26)11-16/h14,16-19,21-24,26,30H,3-13,15H2,1-2H3/t16-,17+,18-,19+,21-,22-,23-,24+,26?,28-,29+/m0/s1

Standard InChI Key:  CECSFCKUXJBSMW-IWEWVUNSSA-N

Molfile:  

     RDKit          2D

 40 46  0  0  1  0  0  0  0  0999 V2000
    3.4822   -6.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3277   -7.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3194   -8.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4739   -6.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0417   -6.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4760   -4.9895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7474   -7.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2630   -5.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8621   -5.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2734   -4.7641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0334   -8.4968    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6138   -8.4968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8663   -6.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5803   -5.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7724   -5.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7557   -8.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0459   -6.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2505   -7.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6138   -6.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7390   -6.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3319   -6.2254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0292   -6.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0960   -8.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2233   -6.8308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3319   -5.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0292   -5.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5803   -6.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8872   -4.4008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7807   -6.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8142   -8.4968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0960   -7.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4739   -5.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3194   -6.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1023   -5.8413    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6012   -4.2630    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1085   -6.5009    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9874   -7.4279    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7474   -6.4442    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4739   -7.6892    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0417   -7.6684    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  2  1  0
  4  1  1  0
  5 17  1  0
  8  6  1  1
  7  4  1  0
  8  1  1  0
  9 10  1  0
 10  6  1  0
 11 16  1  0
 12  3  2  0
 13  9  1  0
 14  9  1  0
 15  1  1  0
 16  7  1  0
 17 15  1  0
 18  4  1  0
 19  2  1  0
 20  8  1  0
 21 25  1  0
 22 26  1  0
 23 31  1  0
 24 13  1  0
 25 14  1  0
 26 14  1  0
 27 13  1  0
 28  6  2  0
 29 22  1  0
 30 23  2  0
 31 19  1  0
  1 32  1  1
  2 33  1  1
 13 34  1  6
 14 35  1  1
 21 36  1  6
 22 37  1  1
 18 20  1  0
  7  5  1  0
  3 11  1  0
 27 21  1  0
 24 22  1  0
 12 23  1  0
 21 29  1  0
  7 38  1  1
  4 39  1  6
  5 40  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA3085538

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 451.65

Molecular Weight (Monoisotopic): 451.3086

AlogP: 5.27

#Rotatable Bonds: 2

Polar Surface Area: 55.40

Molecular Species: NEUTRAL

HBA: 4

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 4

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 4.65

CX LogD: 4.65

Aromatic Rings: ┄

Heavy Atoms: 33

QED Weighted: 0.58

Np Likeness Score: 1.41

References

1. Kenny B, Ballard S, Blagg J, Fox D..  (1997)  Pharmacological options in the treatment of benign prostatic hyperplasia.,  40  (9): [PMID:9135028] [10.1021/jm960697s]

2. Frye SV, Haffner CD, Maloney PR, Mook RA, Dorsey GF, Hiner RN, Cribbs CM, Wheeler TN, Ray JA, Andrews RC..  (1994)  6-Azasteroids: structure-activity relationships for inhibition of type 1 and 2 human 5 alpha-reductase and human adrenal 3 beta-hydroxy-delta 5-steroid dehydrogenase/3-keto-delta 5-steroid isomerase.,  37  (15): [PMID:8057283] [10.1021/jm00041a014]

Source

Source(1):

• Scientific Literature