The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl(2alpha,3beta)2,3-dihydroxy-28-oxo-olean-12-en-28-amide ID: ALA3086616
PubChem CID: 76309817
Max Phase: Preclinical
Molecular Formula: C32H53NO3
Molecular Weight: 499.78
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)C[C@@H](O)[C@H](O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2
Standard InChI: InChI=1S/C32H53NO3/c1-9-33-26(36)32-16-14-27(2,3)18-21(32)20-10-11-24-29(6)19-22(34)25(35)28(4,5)23(29)12-13-31(24,8)30(20,7)15-17-32/h10,21-25,34-35H,9,11-19H2,1-8H3,(H,33,36)/t21-,22+,23-,24+,25-,29-,30+,31+,32-/m0/s1
Standard InChI Key: LTLLHEBETZDVMB-PROZZQCMSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
5.4415 -10.7419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1726 -9.2939 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0068 -8.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3004 -10.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8798 -7.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7540 -6.0172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1523 -8.2785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7215 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4321 -7.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5857 -9.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4276 -8.7035 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.7215 -9.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3004 -9.9175 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.1510 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7288 -5.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4325 -7.0294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 -10.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7215 -8.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8457 -9.9087 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.1595 -6.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0068 -9.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0068 -10.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4341 -9.0899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1562 -10.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1562 -9.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3931 -11.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3004 -9.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3004 -8.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3402 -11.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5857 -8.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4321 -9.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0068 -7.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9549 -8.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8690 -7.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5433 -7.9028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5857 -10.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9813 -9.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2010 -10.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 31 1 1
7 34 1 1
4 22 1 0
25 26 1 0
9 18 1 0
26 23 1 0
37 19 1 6
22 21 1 0
8 18 1 0
26 24 1 6
21 8 1 0
21 28 1 0
37 10 1 0
25 17 1 0
23 10 1 0
37 4 1 0
5 20 1 0
20 6 1 0
17 27 1 0
33 29 1 0
14 7 1 0
28 10 1 0
32 14 1 0
20 15 1 0
28 13 1 6
9 11 1 1
29 28 1 0
21 3 1 1
34 2 1 0
7 35 1 0
8 12 1 6
20 16 1 0
35 5 1 0
8 32 1 0
17 37 1 0
9 7 1 0
17 30 1 0
18 33 2 0
9 16 1 0
25 1 1 1
34 36 2 0
2 38 1 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.78Molecular Weight (Monoisotopic): 499.4025AlogP: 6.26#Rotatable Bonds: 2Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.63CX Basic pKa: 0.49CX LogP: 5.29CX LogD: 5.29Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.39Np Likeness Score: 2.68
References 1. Siewert B, Pianowski E, Csuk R.. (2013) Esters and amides of maslinic acid trigger apoptosis in human tumor cells and alter their mode of action with respect to the substitution pattern at C-28., 70 [PMID:24161703 ] [10.1016/j.ejmech.2013.10.016 ] 2. Schwarz S, Loesche A, Lucas SD, Sommerwerk S, Serbian I, Siewert B, Pianowski E, Csuk R.. (2015) Converting maslinic acid into an effective inhibitor of acylcholinesterases., 103 [PMID:26383128 ] [10.1016/j.ejmech.2015.09.007 ]