The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-1-(2-(6-chloropyrazin-2-ylamino)-2-oxoethyl)-3-(1-(cyclopenta-1,3-dienyl)cycloheptanecarbonyloxy)-1-azoniabicyclo[2.2.2]octane ID: ALA3087949
PubChem CID: 72543916
Max Phase: Preclinical
Molecular Formula: C26H34ClN4O3+
Molecular Weight: 486.04
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(C3=CC=CC3)CCCCCC1)C2)Nc1cncc(Cl)n1
Standard InChI: InChI=1S/C26H33ClN4O3/c27-22-15-28-16-23(29-22)30-24(32)18-31-13-9-19(10-14-31)21(17-31)34-25(33)26(20-7-3-4-8-20)11-5-1-2-6-12-26/h3-4,7,15-16,19,21H,1-2,5-6,8-14,17-18H2/p+1/t19?,21-,31?/m0/s1
Standard InChI Key: UMUGTQBISHLVAE-GIVRZJQPSA-O
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
9.2541 -2.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6296 -3.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7849 -3.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5778 -4.0978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1884 -3.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0336 -2.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8585 -3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6621 -3.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8505 -2.7732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4295 -2.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8841 -3.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0949 -3.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6688 -2.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4400 -1.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9218 -0.8094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7435 -0.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2911 -1.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1507 -2.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0627 -3.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7370 -3.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3608 -4.4608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0719 -4.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9970 -3.9178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6337 -4.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3744 -5.2840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4304 -6.1071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0593 -4.8241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8001 -5.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8530 -6.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5929 -6.3708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2788 -5.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2200 -5.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4797 -4.7242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9032 -4.6211 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 0
4 8 1 0
7 8 1 0
2 9 1 6
11 10 1 0
10 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
13 10 1 0
16 17 1 0
10 18 1 0
17 18 1 0
11 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 11 1 0
12 23 2 0
12 9 1 0
4 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
M CHG 1 4 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.04Molecular Weight (Monoisotopic): 485.2314AlogP: 4.45#Rotatable Bonds: 6Polar Surface Area: 81.18Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.44CX Basic pKa: ┄CX LogP: -0.46CX LogD: -0.44Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: 0.21
References 1. Mete A, Bowers K, Bull RJ, Coope H, Donald DK, Escott KJ, Ford R, Grime K, Mather A, Ray NC, Russell V.. (2013) The design of a novel series of muscarinic receptor antagonists leading to AZD8683, a potential inhaled treatment for COPD., 23 (23): [PMID:24144851 ] [10.1016/j.bmcl.2013.09.092 ]