The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((3-ethyl-5-(5-methoxy-3-methylbenzo[d]thiazol-2(3H)-ylidene)-4-oxothiazolidin-2-ylidene)methyl)-1-(6-(5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanamido)hexyl)pyridinium chloride ID: ALA3091928
PubChem CID: 76324537
Max Phase: Preclinical
Molecular Formula: C36H47ClN6O4S3
Molecular Weight: 724.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1c(=O)/c(=C2\Sc3ccc(OC)cc3N2C)s/c1=C\c1cccc[n+]1CCCCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21.[Cl-]
Standard InChI: InChI=1S/C36H46N6O4S3.ClH/c1-4-42-31(49-33(34(42)44)35-40(2)27-22-25(46-3)16-17-28(27)48-35)21-24-13-9-12-20-41(24)19-11-6-5-10-18-37-30(43)15-8-7-14-29-32-26(23-47-29)38-36(45)39-32;/h9,12-13,16-17,20-22,26,29,32H,4-8,10-11,14-15,18-19,23H2,1-3H3,(H2-,37,38,39,43,45);1H/b35-33+;/t26-,29-,32-;/m0./s1
Standard InChI Key: OBUNQGWPHHISNJ-GAHOZNGTSA-N
Molfile:
RDKit 2D
52 56 0 0 0 0 0 0 0 0999 V2000
10.0333 -16.0838 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2326 -15.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2315 -16.3461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9395 -16.7551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9377 -15.1177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6464 -15.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6466 -16.3462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4296 -16.6003 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9133 -15.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4292 -15.2685 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7288 -15.9342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2094 -16.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9865 -16.3423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9862 -15.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2089 -15.2729 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.6471 -15.0444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5614 -14.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9572 -17.3724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6814 -14.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6478 -16.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5627 -17.6351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2234 -13.7526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1381 -12.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3908 -12.6078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7280 -13.0931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8166 -13.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9696 -14.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6312 -13.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3774 -13.9390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0390 -13.4593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7852 -13.7923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4468 -13.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1930 -13.6457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8546 -13.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6008 -13.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7699 -12.3531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2624 -13.0193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0086 -13.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6702 -12.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4164 -13.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5835 -14.0028 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.3961 -14.0890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1223 -12.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7264 -13.3412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4322 -12.9353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2643 -12.1386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4547 -12.0523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8120 -11.5322 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5378 -12.2125 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.3001 -13.9170 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.5248 -15.1182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5246 -14.3010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 6 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
9 11 2 0
14 16 2 0
16 17 1 0
12 18 2 0
10 19 1 0
13 20 1 0
20 21 1 0
17 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 17 1 0
22 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
40 39 1 1
40 41 1 0
41 42 1 0
42 44 1 0
43 40 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
47 43 1 0
46 48 2 0
43 49 1 6
44 50 1 6
2 51 1 0
51 52 1 0
M CHG 2 1 -1 22 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 724.01Molecular Weight (Monoisotopic): 723.2815AlogP: 3.76#Rotatable Bonds: 15Polar Surface Area: 108.58Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.49CX Basic pKa: ┄CX LogP: 0.79CX LogD: 0.79Aromatic Rings: 3Heavy Atoms: 49QED Weighted: 0.12Np Likeness Score: -0.73
References 1. Li X, Srinivasan SR, Connarn J, Ahmad A, Young ZT, Kabza AM, Zuiderweg ER, Sun D, Gestwicki JE.. (2013) Analogs of the Allosteric Heat Shock Protein 70 (Hsp70) Inhibitor, MKT-077, as Anti-Cancer Agents., 4 (11): [PMID:24312699 ] [10.1021/ml400204n ]