The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,7-Bis(4-((tert-butyldimethylsilyl)oxy)phenyl)-3-(2,4,6-trimethoxyphenyl)hept-4-yn-1-one ID: ALA3092021
PubChem CID: 72724877
Max Phase: Preclinical
Molecular Formula: C40H56O6Si2
Molecular Weight: 689.05
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(OC)c(C(C#CCCc2ccc(O[Si](C)(C)C(C)(C)C)cc2)CC(=O)c2ccc(O[Si](C)(C)C(C)(C)C)cc2)c(OC)c1
Standard InChI: InChI=1S/C40H56O6Si2/c1-39(2,3)47(10,11)45-32-22-18-29(19-23-32)16-14-15-17-31(38-36(43-8)27-34(42-7)28-37(38)44-9)26-35(41)30-20-24-33(25-21-30)46-48(12,13)40(4,5)6/h18-25,27-28,31H,14,16,26H2,1-13H3
Standard InChI Key: PRLFQHHCWWXLCB-UHFFFAOYSA-N
Molfile:
RDKit 2D
48 50 0 0 0 0 0 0 0 0999 V2000
8.4067 -8.5789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4056 -9.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1203 -9.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8368 -9.4058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8339 -8.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1185 -8.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1201 -10.6441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4056 -11.0564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8344 -11.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5561 -9.8255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6866 -9.8307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1202 -7.3412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8293 -6.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5532 -10.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5551 -11.4734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2778 -11.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2776 -12.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9878 -13.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9884 -13.9591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7019 -14.3717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4216 -13.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4233 -13.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7050 -12.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4054 -11.8814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6908 -12.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1197 -12.2941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9786 -11.8799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2645 -12.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2639 -13.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9833 -13.5298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6944 -13.1158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9682 -9.4252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1349 -14.3737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5499 -13.5306 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1327 -15.1987 0.0000 Si 0 0 0 0 0 4 0 0 0 0 0 0
14.1247 -16.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4062 -16.4259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8351 -16.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1205 -16.8454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9577 -15.2038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3077 -15.1967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8350 -13.1189 0.0000 Si 0 0 0 0 0 4 0 0 0 0 0 0
4.0333 -12.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8238 -12.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4469 -13.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2083 -12.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1522 -12.3574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5254 -13.8836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
7 9 1 0
4 10 1 0
2 11 1 0
6 12 1 0
12 13 1 0
10 14 1 0
9 15 3 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
8 24 1 0
24 25 1 0
24 26 2 0
25 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 25 1 0
11 32 1 0
21 33 1 0
29 34 1 0
33 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
35 40 1 0
35 41 1 0
34 42 1 0
42 43 1 0
43 44 1 0
43 45 1 0
43 46 1 0
42 47 1 0
42 48 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 689.05Molecular Weight (Monoisotopic): 688.3615AlogP: ┄#Rotatable Bonds: ┄Polar Surface Area: ┄Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: ┄HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: ┄CX LogD: ┄Aromatic Rings: ┄Heavy Atoms: ┄QED Weighted: ┄Np Likeness Score: ┄
References 1. Campos CA, Gianino JB, Bailey BJ, Baluyut ME, Wiek C, Hanenberg H, Shannon HE, Pollok KE, Ashfeld BL.. (2013) Design, synthesis, and evaluation of curcumin-derived arylheptanoids for glioblastoma and neuroblastoma cytotoxicity., 23 (24): [PMID:24183537 ] [10.1016/j.bmcl.2013.09.095 ]