The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(5Z)-2-[4-[2-[2-(2-Aminoethoxy)ethoxy]ethoxy]phenylamino]-5-(benzo[1,3]dioxol-5-ylmethylene)-3,5-dihydro-imidazol-4-one ID: ALA3092862
PubChem CID: 136234577
Max Phase: Preclinical
Molecular Formula: C23H26N4O6
Molecular Weight: 454.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCOCCOCCOc1ccc(NC2=N/C(=C\c3ccc4c(c3)OCO4)C(=O)N2)cc1
Standard InChI: InChI=1S/C23H26N4O6/c24-7-8-29-9-10-30-11-12-31-18-4-2-17(3-5-18)25-23-26-19(22(28)27-23)13-16-1-6-20-21(14-16)33-15-32-20/h1-6,13-14H,7-12,15,24H2,(H2,25,26,27,28)/b19-13-
Standard InChI Key: LZUJDIWVWSRLRQ-UYRXBGFRSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
7.9733 -11.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9721 -12.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6869 -13.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6851 -11.5159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4004 -11.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4007 -12.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1912 -13.0127 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6795 -12.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1907 -11.6681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2573 -13.1679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5432 -12.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4606 -11.9315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6538 -11.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2407 -12.4735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7923 -13.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6196 -13.8936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3188 -11.0054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8043 -10.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6283 -10.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1136 -9.7626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7786 -9.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9537 -8.9230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4721 -9.5902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2632 -8.3400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0837 -8.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5683 -7.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3887 -7.8439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8733 -7.1762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6938 -7.2621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1783 -6.5944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9988 -6.6802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4834 -6.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3038 -6.0983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
2 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 11 1 0
15 16 2 0
13 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.48Molecular Weight (Monoisotopic): 454.1852AlogP: 1.72#Rotatable Bonds: 11Polar Surface Area: 125.66Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.01CX Basic pKa: 9.31CX LogP: 1.11CX LogD: -0.48Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.35Np Likeness Score: -0.50
References 1. Burgy G, Tahtouh T, Durieu E, Foll-Josselin B, Limanton E, Meijer L, Carreaux F, Bazureau JP.. (2013) Chemical synthesis and biological validation of immobilized protein kinase inhibitory Leucettines., 62 [PMID:23454515 ] [10.1016/j.ejmech.2013.01.035 ]