The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,4S)-N-(cyanomethyl)-4-(morpholine-4-carbonyl)-1-(phenylsulfonyl)pyrrolidine-3-carboxamide ID: ALA3093943
PubChem CID: 72793721
Max Phase: Preclinical
Molecular Formula: C18H22N4O5S
Molecular Weight: 406.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N#CCNC(=O)[C@@H]1CN(S(=O)(=O)c2ccccc2)C[C@H]1C(=O)N1CCOCC1
Standard InChI: InChI=1S/C18H22N4O5S/c19-6-7-20-17(23)15-12-22(28(25,26)14-4-2-1-3-5-14)13-16(15)18(24)21-8-10-27-11-9-21/h1-5,15-16H,7-13H2,(H,20,23)/t15-,16-/m1/s1
Standard InChI Key: VXNVJCGMKWPZNC-HZPDHXFCSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
10.6084 -10.3138 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.7669 -11.1154 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3819 -10.5773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8719 -9.5402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6523 -9.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6648 -8.4806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8887 -8.2169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4026 -8.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3327 -8.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6450 -7.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1987 -6.8358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.8477 -7.2578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6049 -6.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8115 -6.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2545 -6.8913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4965 -7.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2956 -7.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0744 -8.3528 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2590 -7.1959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.7424 -7.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4841 -8.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2251 -8.5660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8067 -10.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2712 -9.8555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4702 -10.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2060 -10.7877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7488 -11.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5478 -11.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 3 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
6 9 1 6
7 10 1 1
10 11 2 0
10 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
9 18 1 0
9 19 2 0
18 20 1 0
20 21 1 0
21 22 3 0
4 1 1 0
1 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.46Molecular Weight (Monoisotopic): 406.1311AlogP: -0.58#Rotatable Bonds: 5Polar Surface Area: 119.81Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.61CX Basic pKa: ┄CX LogP: -1.44CX LogD: -1.44Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.65Np Likeness Score: -1.82
References 1. Hilpert H, Mauser H, Humm R, Anselm L, Kuehne H, Hartmann G, Gruener S, Banner DW, Benz J, Gsell B, Kuglstatter A, Stihle M, Thoma R, Sanchez RA, Iding H, Wirz B, Haap W.. (2013) Identification of potent and selective cathepsin S inhibitors containing different central cyclic scaffolds., 56 (23): [PMID:24224654 ] [10.1021/jm401528k ]