The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-{[6-(2,4-Diamino-6-oxo-1,6-dihydro-pyrimidin-5-ylsulfanylmethyl)-4,5,6,7-tetrahydro-benzo[b]thiophene-2-carbonyl]-amino}-pentanedioic acid ID: ALA309415
PubChem CID: 135497378
Max Phase: Preclinical
Molecular Formula: C19H23N5O6S2
Molecular Weight: 481.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(N)c(SCC2CCc3cc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)sc3C2)c(O)n1
Standard InChI: InChI=1S/C19H23N5O6S2/c20-15-14(17(28)24-19(21)23-15)31-7-8-1-2-9-6-12(32-11(9)5-8)16(27)22-10(18(29)30)3-4-13(25)26/h6,8,10H,1-5,7H2,(H,22,27)(H,25,26)(H,29,30)(H5,20,21,23,24,28)/t8?,10-/m0/s1
Standard InChI Key: ZGMCQEIDLHETAQ-HTLJXXAVSA-N
Molfile:
RDKit 2D
32 34 0 0 1 0 0 0 0 0999 V2000
0.0417 -4.1542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7542 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7542 -3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6708 -2.9167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0417 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6708 -3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5875 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1042 -2.7625 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3167 -2.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3167 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4125 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1125 -1.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 -2.4917 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.8250 -2.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0625 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6500 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0417 -1.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2875 -4.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6042 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8292 -1.3875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4667 -4.1542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6042 -1.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8875 -2.1125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3875 -4.1417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8750 -4.9667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0500 -3.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1875 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8750 -3.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6542 -1.3917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8917 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1125 -4.2542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8917 -1.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 1 2 0
4 6 2 0
5 4 1 0
6 1 1 0
7 8 1 0
8 9 1 0
9 19 1 0
10 22 1 0
11 7 1 0
12 10 1 0
13 2 1 0
14 11 1 0
16 15 1 6
16 14 1 0
17 5 1 0
18 28 1 0
19 30 1 0
20 11 2 0
21 3 1 0
22 32 1 0
23 15 2 0
24 6 1 0
25 18 2 0
26 16 1 0
27 13 1 0
28 26 1 0
29 15 1 0
30 27 1 0
31 18 1 0
32 30 1 0
2 5 2 0
10 9 2 0
7 12 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.56Molecular Weight (Monoisotopic): 481.1090AlogP: 1.35#Rotatable Bonds: 9Polar Surface Area: 201.75Molecular Species: ACIDHBA: 10HBD: 6#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.73CX Basic pKa: 4.04CX LogP: 1.70CX LogD: -4.03Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.28Np Likeness Score: -0.51
References 1. Varney MD, Palmer CL, Romines WH, Boritzki T, Margosiak SA, Almassy R, Janson CA, Bartlett C, Howland EJ, Ferre R.. (1997) Protein structure-based design, synthesis, and biological evaluation of 5-thia-2,6-diamino-4(3H)-oxopyrimidines: potent inhibitors of glycinamide ribonucleotide transformylase with potent cell growth inhibition., 40 (16): [PMID:9258357 ] [10.1021/jm9607459 ]