The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-3-((5-bromo-4-(4-chlorophenyl)oxazol-2-yl)(pyridin-3-yl)methoxy)-2,6-difluorobenzamide ID: ALA3098677
PubChem CID: 70980286
Max Phase: Preclinical
Molecular Formula: C22H13BrClF2N3O3
Molecular Weight: 520.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(F)ccc(OC(c2cccnc2)c2nc(-c3ccc(Cl)cc3)c(Br)o2)c1F
Standard InChI: InChI=1S/C22H13BrClF2N3O3/c23-20-18(11-3-5-13(24)6-4-11)29-22(32-20)19(12-2-1-9-28-10-12)31-15-8-7-14(25)16(17(15)26)21(27)30/h1-10,19H,(H2,27,30)
Standard InChI Key: MWLJSWIGWFXOMH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
12.1161 -18.1721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1150 -18.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8230 -19.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5327 -18.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5299 -18.1686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8212 -17.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4083 -17.7637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4081 -16.9465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7007 -18.1725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4069 -19.3997 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8188 -16.9461 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.2360 -17.7573 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9453 -18.1632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6514 -17.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4008 -18.0863 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7354 -16.9438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.5341 -16.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9441 -17.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8631 -16.0252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6768 -15.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0070 -15.1920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5246 -14.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7082 -14.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3818 -15.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7570 -17.5607 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
17.8538 -13.7833 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.9508 -18.9779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2431 -19.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2458 -20.2049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9556 -20.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6641 -20.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6578 -19.3810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 2 0
7 9 1 0
2 10 1 0
6 11 1 0
5 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 18 1 0
17 16 1 0
16 14 2 0
17 18 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 19 1 0
18 25 1 0
22 26 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
13 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.72Molecular Weight (Monoisotopic): 518.9797AlogP: 5.70#Rotatable Bonds: 6Polar Surface Area: 91.24Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.95CX Basic pKa: 4.64CX LogP: 4.52CX LogD: 4.52Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.35Np Likeness Score: -1.17
References 1. Stokes NR, Baker N, Bennett JM, Chauhan PK, Collins I, Davies DT, Gavade M, Kumar D, Lancett P, Macdonald R, Macleod L, Mahajan A, Mitchell JP, Nayal N, Nayal YN, Pitt GR, Singh M, Yadav A, Srivastava A, Czaplewski LG, Haydon DJ.. (2014) Design, synthesis and structure-activity relationships of substituted oxazole-benzamide antibacterial inhibitors of FtsZ., 24 (1): [PMID:24287381 ] [10.1016/j.bmcl.2013.11.002 ]