rac-3-(1-(5-bromo-4-(4-(trifluoromethyl)phenyl)oxazol-2-yl)-3-hydroxypropoxy)-2,6-difluorobenzamide

ID: ALA3098678

PubChem CID: 66574789

Max Phase: Preclinical

Molecular Formula: C20H14BrF5N2O4

Molecular Weight: 521.24

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)c1c(F)ccc(OC(CCO)c2nc(-c3ccc(C(F)(F)F)cc3)c(Br)o2)c1F

Standard InChI:  InChI=1S/C20H14BrF5N2O4/c21-17-16(9-1-3-10(4-2-9)20(24,25)26)28-19(32-17)13(7-8-29)31-12-6-5-11(22)14(15(12)23)18(27)30/h1-6,13,29H,7-8H2,(H2,27,30)

Standard InChI Key:  LGROMENIPXXFFI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   21.8399  -18.3414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8387  -19.1609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5468  -19.5699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2564  -19.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2536  -18.3378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5450  -17.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1321  -17.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1319  -17.1157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4245  -18.3417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1307  -19.5689    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.5425  -17.1153    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.9598  -17.9265    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6690  -18.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3752  -17.9212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1246  -18.2555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4592  -17.1130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2578  -16.9400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6678  -17.6470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5869  -16.1944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4006  -16.1078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7308  -15.3612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2484  -14.7005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4320  -14.7913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1055  -15.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5776  -13.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3899  -13.8637    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.0944  -13.2935    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.7845  -13.1576    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.4808  -17.7299    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   24.6721  -19.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9659  -19.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9690  -20.3781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  2 10  1  0
  6 11  1  0
  5 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 18  1  0
 17 16  1  0
 16 14  2  0
 17 18  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 19  1  0
 22 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
 18 29  1  0
 13 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Associated Targets(non-human)

ftsZ Cell division protein ftsZ (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus aureus (210822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.24Molecular Weight (Monoisotopic): 520.0057AlogP: 5.00#Rotatable Bonds: 7
Polar Surface Area: 98.58Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.96CX Basic pKa: CX LogP: 3.65CX LogD: 3.65
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -0.75

References

1. Stokes NR, Baker N, Bennett JM, Chauhan PK, Collins I, Davies DT, Gavade M, Kumar D, Lancett P, Macdonald R, Macleod L, Mahajan A, Mitchell JP, Nayal N, Nayal YN, Pitt GR, Singh M, Yadav A, Srivastava A, Czaplewski LG, Haydon DJ..  (2014)  Design, synthesis and structure-activity relationships of substituted oxazole-benzamide antibacterial inhibitors of FtsZ.,  24  (1): [PMID:24287381] [10.1016/j.bmcl.2013.11.002]

Source