rac-3-(1-(5-bromo-4-(4-chlorophenyl)oxazol-2-yl)propoxy)-2,6-difluorobenzamide

ID: ALA3098790

PubChem CID: 66575005

Max Phase: Preclinical

Molecular Formula: C19H14BrClF2N2O3

Molecular Weight: 471.69

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(Oc1ccc(F)c(C(N)=O)c1F)c1nc(-c2ccc(Cl)cc2)c(Br)o1

Standard InChI:  InChI=1S/C19H14BrClF2N2O3/c1-2-12(27-13-8-7-11(22)14(15(13)23)18(24)26)19-25-16(17(20)28-19)9-3-5-10(21)6-4-9/h3-8,12H,2H2,1H3,(H2,24,26)

Standard InChI Key:  NKBKZEWTZNJEDA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   21.5716  -11.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5705  -12.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2785  -12.8672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9882  -12.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9853  -11.6351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2767  -11.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8638  -11.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8636  -10.4131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1562  -11.6391    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8624  -12.8663    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.2743  -10.4127    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.6915  -11.2239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4007  -11.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1069  -11.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8563  -11.5529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1909  -10.4104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.9896  -10.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3995  -10.9444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3186   -9.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1323   -9.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4625   -8.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9801   -7.9979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1637   -8.0887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8372   -8.8356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2125  -11.0272    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   27.3093   -7.2499    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   24.4038  -12.4470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6977  -12.8583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  2  0
  7  9  1  0
  2 10  1  0
  6 11  1  0
  5 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 18  1  0
 17 16  1  0
 16 14  2  0
 17 18  2  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 17 19  1  0
 18 25  1  0
 22 26  1  0
 13 27  1  0
 27 28  1  0
M  END

Associated Targets(non-human)

ftsZ Cell division protein ftsZ (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Staphylococcus aureus (210822 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.69Molecular Weight (Monoisotopic): 469.9844AlogP: 5.66#Rotatable Bonds: 6
Polar Surface Area: 78.35Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.96CX Basic pKa: CX LogP: 4.89CX LogD: 4.89
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.50Np Likeness Score: -0.98

References

1. Stokes NR, Baker N, Bennett JM, Chauhan PK, Collins I, Davies DT, Gavade M, Kumar D, Lancett P, Macdonald R, Macleod L, Mahajan A, Mitchell JP, Nayal N, Nayal YN, Pitt GR, Singh M, Yadav A, Srivastava A, Czaplewski LG, Haydon DJ..  (2014)  Design, synthesis and structure-activity relationships of substituted oxazole-benzamide antibacterial inhibitors of FtsZ.,  24  (1): [PMID:24287381] [10.1016/j.bmcl.2013.11.002]

Source