The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(5-methyl-1-phenyl-3-(3,4,5-trimethoxyphenyl)-1H-pyrazol-4-yl)-5-phenyl-1,3,4-oxadiazole ID: ALA3099515
PubChem CID: 72947074
Max Phase: Preclinical
Molecular Formula: C27H24N4O4
Molecular Weight: 468.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2nn(-c3ccccc3)c(C)c2-c2nnc(-c3ccccc3)o2)cc(OC)c1OC
Standard InChI: InChI=1S/C27H24N4O4/c1-17-23(27-29-28-26(35-27)18-11-7-5-8-12-18)24(30-31(17)20-13-9-6-10-14-20)19-15-21(32-2)25(34-4)22(16-19)33-3/h5-16H,1-4H3
Standard InChI Key: VLGXCUGKEIVWQJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.8008 -19.2493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9836 -19.2452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7271 -20.0211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3859 -20.5049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0493 -20.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3810 -21.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6696 -21.7235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6652 -22.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3714 -22.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0835 -22.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0844 -21.7284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8252 -20.2842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5088 -18.5837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8467 -17.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3704 -17.1752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5564 -17.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2209 -18.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6992 -18.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2840 -18.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1011 -18.5976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3576 -17.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6989 -17.3379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0354 -17.8150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1363 -17.5737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7407 -18.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5186 -17.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6932 -17.0781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0838 -16.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3083 -16.7783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4080 -18.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0713 -17.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0785 -16.5932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4137 -15.8479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7070 -16.4305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5201 -16.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 1 2 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
4 6 1 0
5 12 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 13 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 2 0
1 19 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 24 1 0
17 30 1 0
30 31 1 0
16 32 1 0
32 33 1 0
15 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.51Molecular Weight (Monoisotopic): 468.1798AlogP: 5.59#Rotatable Bonds: 7Polar Surface Area: 84.43Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.27CX LogP: 4.85CX LogD: 4.85Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -0.86
References 1. Ningaiah S, Bhadraiah UK, Doddaramappa SD, Keshavamurthy S, Javarasetty C.. (2014) Novel pyrazole integrated 1,3,4-oxadiazoles: synthesis, characterization and antimicrobial evaluation., 24 (1): [PMID:24316123 ] [10.1016/j.bmcl.2013.11.029 ]