The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-aminoquinazolin-6-yl)-N-(4,4-dimethyl-2-oxo-1,2,3,4-tetrahydroquinolin-7-yl)-2-fluorobenzamide ID: ALA3099719
PubChem CID: 58829329
Max Phase: Preclinical
Molecular Formula: C26H22FN5O2
Molecular Weight: 455.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC(=O)Nc2cc(NC(=O)c3cc(-c4ccc5nc(N)ncc5c4)ccc3F)ccc21
Standard InChI: InChI=1S/C26H22FN5O2/c1-26(2)12-23(33)31-22-11-17(5-6-19(22)26)30-24(34)18-10-15(3-7-20(18)27)14-4-8-21-16(9-14)13-29-25(28)32-21/h3-11,13H,12H2,1-2H3,(H,30,34)(H,31,33)(H2,28,29,32)
Standard InChI Key: CPSBEKUNRLHZKJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
6.4500 -15.6033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8667 -14.8908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0414 -14.8862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1524 -16.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1513 -17.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8660 -17.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5824 -17.3674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5796 -16.5370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8642 -16.1279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4379 -16.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4377 -15.3034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7236 -16.5410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0090 -16.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4365 -17.7799 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.2893 -16.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0056 -16.5347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9944 -14.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2849 -15.3016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7153 -15.2944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7176 -16.1180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4310 -16.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1425 -16.1115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1362 -15.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4223 -14.8804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0125 -15.3032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5864 -16.1328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3007 -16.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5835 -15.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3016 -14.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3024 -14.0651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5859 -13.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8672 -14.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5852 -12.8254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8473 -14.8666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
5 14 1 0
15 16 2 0
16 20 1 0
19 17 1 0
17 18 2 0
18 15 1 0
8 15 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 19 2 0
13 25 2 0
25 29 1 0
28 26 1 0
26 27 2 0
27 13 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 32 1 0
32 2 1 0
2 28 1 0
31 33 2 0
23 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.49Molecular Weight (Monoisotopic): 455.1758AlogP: 4.89#Rotatable Bonds: 3Polar Surface Area: 110.00Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.47CX Basic pKa: 4.04CX LogP: 4.29CX LogD: 4.29Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -0.85
References 1. Huang H, Guzman-Perez A, Acquaviva L, Berry V, Bregman H, Dovey J, Gunaydin H, Huang X, Huang L, Saffran D, Serafino R, Schneider S, Wilson C, DiMauro EF.. (2013) Structure-based design of 2-aminopyridine oxazolidinones as potent and selective tankyrase inhibitors., 4 (12): [PMID:24900633 ] [10.1021/ml4003315 ]