(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxotetracyclo[7.5.1.0^{1,5}.0^{10,12}]pentadeca-2,7-dien-4-yl 2-chloro-6-(methylamino)benzoate

ID: ALA3102881

PubChem CID: 68036707

Max Phase: Preclinical

Molecular Formula: C28H34ClNO6

Molecular Weight: 516.03

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNc1cccc(Cl)c1C(=O)O[C@H]1C(C)=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]12O)[C@H]1[C@@H](C[C@H]3C)C1(C)C

Standard InChI:  InChI=1S/C28H34ClNO6/c1-13-11-27-14(2)9-17-21(26(17,3)4)16(23(27)33)10-15(12-31)22(32)28(27,35)24(13)36-25(34)20-18(29)7-6-8-19(20)30-5/h6-8,10-11,14,16-17,21-22,24,30-32,35H,9,12H2,1-5H3/t14-,16+,17-,21+,22-,24+,27+,28+/m1/s1

Standard InChI Key:  NCKXXTVKZTZRMQ-XUBYYPQFSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    8.9055  -10.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9484   -8.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3227   -9.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6220   -8.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8717  -10.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6266  -10.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2528  -11.3454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4719  -11.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1602   -9.8888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6789  -10.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1044  -11.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5520   -9.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4096   -8.9255    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8795  -10.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7191  -11.8690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6982  -11.7393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2578  -12.2550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7273  -11.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5259  -11.9075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2328   -8.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3888   -8.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6965   -9.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1829   -8.5822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3811   -7.6709    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.2588   -9.7824    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3839   -7.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9562   -8.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0170  -10.3124    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9020  -11.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5044  -12.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6871  -12.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2896  -13.3177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7092  -14.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5304  -14.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9243  -13.2910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4825  -11.1803    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7413  -13.2751    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.2693  -11.9023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4444  -11.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
 22  3  1  0
 21  4  1  0
  2  4  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  7  8  1  0
  5  8  1  0
  9 10  2  0
 10 11  1  0
  5 11  1  0
  1  9  1  6
  3 12  1  0
  1 12  1  0
 12 13  2  0
 10 14  1  0
 11 15  1  1
  5 16  1  1
  8 17  1  1
  7 18  1  0
 18 19  1  0
  2 20  1  6
 22 21  1  0
 23 22  1  0
 21 23  1  0
 21 24  1  6
 22 25  1  6
 23 26  1  0
 23 27  1  0
  3 28  1  1
 15 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 29 36  2  0
 35 37  1  0
 31 38  1  0
 38 39  1  0
M  END

Associated Targets(Human)

PRKCD Tclin Protein kinase C delta (2953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.03Molecular Weight (Monoisotopic): 515.2075AlogP: 3.38#Rotatable Bonds: 4
Polar Surface Area: 116.09Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.13CX Basic pKa: 1.73CX LogP: 3.51CX LogD: 3.51
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: 2.31

References

1. Grue-Sørensen G, Liang X, Månsson K, Vedsø P, Dahl Sørensen M, Soor A, Stahlhut M, Bertelsen M, Engell KM, Högberg T..  (2014)  Synthesis, biological evaluation and SAR of 3-benzoates of ingenol for treatment of actinic keratosis and non-melanoma skin cancer.,  24  (1): [PMID:24332494] [10.1016/j.bmcl.2013.11.073]

Source