N-benzyl-4-methyl-2-(2-phenylacetamido)thiazole-5-carboxamide

ID: ALA3104607

PubChem CID: 59369702

Max Phase: Preclinical

Molecular Formula: C20H19N3O2S

Molecular Weight: 365.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc(NC(=O)Cc2ccccc2)sc1C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C20H19N3O2S/c1-14-18(19(25)21-13-16-10-6-3-7-11-16)26-20(22-14)23-17(24)12-15-8-4-2-5-9-15/h2-11H,12-13H2,1H3,(H,21,25)(H,22,23,24)

Standard InChI Key:  XNDFTRNFNLLUBC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    9.5861  -25.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5850  -26.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2930  -26.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0027  -26.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9999  -25.2137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2912  -24.8085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7110  -26.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4181  -26.0342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1265  -26.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8335  -26.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1277  -27.2588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5762  -26.3643    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.1220  -25.7562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7123  -25.0491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9133  -25.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3037  -24.6761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9349  -25.8403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4142  -25.1785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2270  -25.2626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0806  -24.4324    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.7063  -24.6007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5175  -24.6880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9966  -24.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6631  -23.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8458  -23.1980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3703  -23.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 10  2  0
 15 16  1  0
 13 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
M  END

Associated Targets(Human)

FADS2 Tbio Fatty acid desaturase 2 (102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FADS1 Tchem Fatty acid desaturase 1 (145 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SCD Tchem Acyl-CoA desaturase (1011 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Scd1 Acyl-CoA desaturase 1 (352 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 365.46Molecular Weight (Monoisotopic): 365.1198AlogP: 3.56#Rotatable Bonds: 6
Polar Surface Area: 71.09Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.82CX Basic pKa: CX LogP: 3.45CX LogD: 3.32
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.70Np Likeness Score: -1.99

References

1. Sun S, Zhang Z, Kodumuru V, Pokrovskaia N, Fonarev J, Jia Q, Leung PY, Tran J, Ratkay LG, McLaren DG, Radomski C, Chowdhury S, Fu J, Hubbard B, Winther MD, Dales NA..  (2014)  Systematic evaluation of amide bioisosteres leading to the discovery of novel and potent thiazolylimidazolidinone inhibitors of SCD1 for the treatment of metabolic diseases.,  24  (2): [PMID:24374272] [10.1016/j.bmcl.2013.12.036]

Source