N-benzyl-2-(3-benzylisoxazol-5-yl)-4-methylthiazole-5-carboxamide

ID: ALA3104611

PubChem CID: 24960062

Max Phase: Preclinical

Molecular Formula: C22H19N3O2S

Molecular Weight: 389.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nc(-c2cc(Cc3ccccc3)no2)sc1C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C22H19N3O2S/c1-15-20(21(26)23-14-17-10-6-3-7-11-17)28-22(24-15)19-13-18(25-27-19)12-16-8-4-2-5-9-16/h2-11,13H,12,14H2,1H3,(H,23,26)

Standard InChI Key:  VVCCFRMGZHTIFG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   12.9168   -5.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9157   -6.1271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6237   -6.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3334   -6.1266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3305   -5.3040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6219   -4.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0417   -6.5341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7488   -6.1244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4571   -6.5319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1642   -6.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4584   -7.3491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9069   -6.4546    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   18.4527   -5.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0430   -5.1393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2440   -5.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6344   -4.7664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2671   -5.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6769   -6.6319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.4759   -6.4607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5601   -5.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8130   -5.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2671   -5.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9755   -5.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9720   -6.4602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6795   -6.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3875   -6.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3835   -5.6363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6754   -5.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 10  2  0
 15 16  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 17  2  0
 13 17  1  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
M  END

Associated Targets(Human)

FADS2 Tbio Fatty acid desaturase 2 (102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FADS1 Tchem Fatty acid desaturase 1 (145 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SCD Tchem Acyl-CoA desaturase (1011 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Scd1 Acyl-CoA desaturase 1 (352 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 389.48Molecular Weight (Monoisotopic): 389.1198AlogP: 4.63#Rotatable Bonds: 6
Polar Surface Area: 68.02Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.17CX Basic pKa: CX LogP: 3.97CX LogD: 3.97
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.52Np Likeness Score: -1.81

References

1. Sun S, Zhang Z, Kodumuru V, Pokrovskaia N, Fonarev J, Jia Q, Leung PY, Tran J, Ratkay LG, McLaren DG, Radomski C, Chowdhury S, Fu J, Hubbard B, Winther MD, Dales NA..  (2014)  Systematic evaluation of amide bioisosteres leading to the discovery of novel and potent thiazolylimidazolidinone inhibitors of SCD1 for the treatment of metabolic diseases.,  24  (2): [PMID:24374272] [10.1016/j.bmcl.2013.12.036]

Source