(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxotetracyclo[7.5.1.0^{1,5}.0^{10,12}]pentadeca-2,7-dien-4-yl 2-methylbenzoate

ID: ALA3105090

PubChem CID: 68036691

Max Phase: Preclinical

Molecular Formula: C28H34O6

Molecular Weight: 466.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1ccccc1C)[C@H]1[C@@H](C[C@H]3C)C1(C)C

Standard InChI:  InChI=1S/C28H34O6/c1-14-8-6-7-9-18(14)25(32)34-24-15(2)12-27-16(3)10-20-21(26(20,4)5)19(23(27)31)11-17(13-29)22(30)28(24,27)33/h6-9,11-12,16,19-22,24,29-30,33H,10,13H2,1-5H3/t16-,19+,20-,21+,22-,24+,27+,28+/m1/s1

Standard InChI Key:  PLCYLDKOPKFRJP-PBQDKQMHSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   35.2455   -3.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2884   -2.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6627   -3.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9619   -1.9214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2116   -4.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9665   -4.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5928   -4.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8118   -5.1402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5002   -3.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0188   -4.1713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4444   -4.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8920   -3.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7495   -2.5779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.2194   -4.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0591   -5.5213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.0381   -5.3916    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.5977   -5.9073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0673   -5.6466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8658   -5.5598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5727   -2.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7288   -2.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0365   -2.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5228   -2.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7211   -1.3232    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.5987   -3.4348    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.7239   -1.4546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.2962   -2.4405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3570   -3.9647    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   33.2420   -5.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8444   -6.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0271   -6.2569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6296   -6.9700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0491   -7.6723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8704   -7.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2642   -6.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8225   -4.8326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6093   -5.5546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
 22  3  1  0
 21  4  1  0
  2  4  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  7  8  1  0
  5  8  1  0
  9 10  2  0
 10 11  1  0
  5 11  1  0
  1  9  1  6
  3 12  1  0
  1 12  1  0
 12 13  2  0
 10 14  1  0
 11 15  1  1
  5 16  1  1
  8 17  1  1
  7 18  1  0
 18 19  1  0
  2 20  1  6
 22 21  1  0
 23 22  1  0
 21 23  1  0
 21 24  1  6
 22 25  1  6
 23 26  1  0
 23 27  1  0
  3 28  1  1
 15 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 29 36  2  0
 31 37  1  0
M  END

Associated Targets(Human)

PRKCD Tclin Protein kinase C delta (2953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.57Molecular Weight (Monoisotopic): 466.2355AlogP: 2.99#Rotatable Bonds: 3
Polar Surface Area: 104.06Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.13CX Basic pKa: CX LogP: 3.30CX LogD: 3.30
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: 2.54

References

1. Grue-Sørensen G, Liang X, Månsson K, Vedsø P, Dahl Sørensen M, Soor A, Stahlhut M, Bertelsen M, Engell KM, Högberg T..  (2014)  Synthesis, biological evaluation and SAR of 3-benzoates of ingenol for treatment of actinic keratosis and non-melanoma skin cancer.,  24  (1): [PMID:24332494] [10.1016/j.bmcl.2013.11.073]

Source