(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxotetracyclo[7.5.1.0^{1,5}.0^{10,12}]pentadeca-2,7-dien-4-yl 2-aminobenzoate

ID: ALA3105097

PubChem CID: 76317401

Max Phase: Preclinical

Molecular Formula: C27H33NO6

Molecular Weight: 467.56

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1OC(=O)c1ccccc1N)[C@H]1[C@@H](C[C@H]3C)C1(C)C

Standard InChI:  InChI=1S/C27H33NO6/c1-13-11-26-14(2)9-18-20(25(18,3)4)17(22(26)31)10-15(12-29)21(30)27(26,33)23(13)34-24(32)16-7-5-6-8-19(16)28/h5-8,10-11,14,17-18,20-21,23,29-30,33H,9,12,28H2,1-4H3/t14-,17+,18-,20+,21-,23+,26+,27+/m1/s1

Standard InChI Key:  QAGNFHNGTPNOJC-QVFPCUKTSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   12.1165  -12.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1594  -10.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5337  -11.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8329  -10.1222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0826  -12.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8375  -12.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4638  -13.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6828  -13.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3712  -11.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8898  -12.3721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3154  -13.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7630  -11.5574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6205  -10.7787    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0904  -12.3298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9301  -13.7221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9091  -13.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4687  -14.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9383  -13.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7368  -13.7606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4437  -10.2820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5998  -10.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9075  -11.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3939  -10.4354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5921   -9.5240    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.4698  -11.6356    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.5949   -9.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1672  -10.6413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2280  -12.1655    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1130  -13.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7154  -14.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8981  -14.4577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5006  -15.1708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9201  -15.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7414  -15.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1352  -15.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6935  -13.0335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9512  -15.1266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
 22  3  1  0
 21  4  1  0
  2  4  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  7  8  1  0
  5  8  1  0
  9 10  2  0
 10 11  1  0
  5 11  1  0
  1  9  1  6
  3 12  1  0
  1 12  1  0
 12 13  2  0
 10 14  1  0
 11 15  1  1
  5 16  1  1
  8 17  1  1
  7 18  1  0
 18 19  1  0
  2 20  1  6
 22 21  1  0
 23 22  1  0
 21 23  1  0
 21 24  1  6
 22 25  1  6
 23 26  1  0
 23 27  1  0
  3 28  1  1
 15 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 29 36  2  0
 35 37  1  0
M  END

Associated Targets(Human)

PRKCD Tclin Protein kinase C delta (2953 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HeLa (62764 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.56Molecular Weight (Monoisotopic): 467.2308AlogP: 2.26#Rotatable Bonds: 3
Polar Surface Area: 130.08Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 12.13CX Basic pKa: 2.10CX LogP: 2.61CX LogD: 2.61
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: 2.73

References

1. Grue-Sørensen G, Liang X, Månsson K, Vedsø P, Dahl Sørensen M, Soor A, Stahlhut M, Bertelsen M, Engell KM, Högberg T..  (2014)  Synthesis, biological evaluation and SAR of 3-benzoates of ingenol for treatment of actinic keratosis and non-melanoma skin cancer.,  24  (1): [PMID:24332494] [10.1016/j.bmcl.2013.11.073]

Source