Ingenol 3-(2-methyl-6-methylamino)-benzoate

ID: ALA3105111

PubChem CID: 68036661

Max Phase: Preclinical

Molecular Formula: C29H37NO6

Molecular Weight: 495.62

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CNc1cccc(C)c1C(=O)O[C@H]1C(C)=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@]12O)[C@H]1[C@@H](C[C@H]3C)C1(C)C

Standard InChI:  InChI=1S/C29H37NO6/c1-14-8-7-9-20(30-6)21(14)26(34)36-25-15(2)12-28-16(3)10-19-22(27(19,4)5)18(24(28)33)11-17(13-31)23(32)29(25,28)35/h7-9,11-12,16,18-19,22-23,25,30-32,35H,10,13H2,1-6H3/t16-,18+,19-,22+,23-,25+,28+,29+/m1/s1

Standard InChI Key:  NQMJARVOKIAYRJ-AAAGRHJESA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    9.1723  -10.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2165   -9.0550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6320  -10.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9103   -8.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1375  -11.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9450  -10.9716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5600  -11.6854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7557  -11.8321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4047  -10.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9090  -10.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3472  -11.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8382   -9.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6916   -9.1929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0856  -10.7905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9504  -12.2246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9588  -12.0911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5352  -12.6222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0487  -12.3537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8713  -12.2643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4795   -8.6815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7001   -8.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0170   -9.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5180   -8.8394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6922   -7.9008    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5962  -10.0755    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.7250   -8.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3145   -9.0514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3471  -10.6214    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1088  -12.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6993  -12.9730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8575  -12.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4481  -13.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8803  -14.4401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7261  -14.4242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1318  -13.6893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6767  -11.5153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9733  -13.6729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4272  -12.2589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5776  -12.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
 22  3  1  0
 21  4  1  0
  2  4  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  7  8  1  0
  5  8  1  0
  9 10  2  0
 10 11  1  0
  5 11  1  0
  1  9  1  6
  3 12  1  0
  1 12  1  0
 12 13  2  0
 10 14  1  0
 11 15  1  1
  5 16  1  1
  8 17  1  1
  7 18  1  0
 18 19  1  0
  2 20  1  6
 22 21  1  0
 23 22  1  0
 21 23  1  0
 21 24  1  6
 22 25  1  6
 23 26  1  0
 23 27  1  0
  3 28  1  1
 15 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 29 36  2  0
 35 37  1  0
 31 38  1  0
 38 39  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3105111

   [(1S,4S,5S,6R,9S,10R,12R,14R)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-15-oxo-4-tetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dienyl] 2-methyl-6-(methylamino)benzoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 495.62

Molecular Weight (Monoisotopic): 495.2621

AlogP: 3.03

#Rotatable Bonds: 4

Polar Surface Area: 116.09

Molecular Species: NEUTRAL

HBA: 7

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 7

HBD (Lipinski): 4

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 12.13

CX Basic pKa: 2.26

CX LogP: 3.42

CX LogD: 3.42

Aromatic Rings: 1

Heavy Atoms: 36

QED Weighted: 0.37

Np Likeness Score: 2.46

References

1. Grue-Sørensen G, Liang X, Månsson K, Vedsø P, Dahl Sørensen M, Soor A, Stahlhut M, Bertelsen M, Engell KM, Högberg T..  (2014)  Synthesis, biological evaluation and SAR of 3-benzoates of ingenol for treatment of actinic keratosis and non-melanoma skin cancer.,  24  (1): [PMID:24332494] [10.1016/j.bmcl.2013.11.073]

Source

Source(1):

• Scientific Literature