2-(3-fluoro-4-methylphenyl)-N-(4-(N-(5-methylisoxazol-3-yl)sulfamoyl)phenyl)acetamide

ID: ALA3108849

PubChem CID: 53255432

Max Phase: Preclinical

Molecular Formula: C19H18FN3O4S

Molecular Weight: 403.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(C)c(F)c3)cc2)no1

Standard InChI:  InChI=1S/C19H18FN3O4S/c1-12-3-4-14(10-17(12)20)11-19(24)21-15-5-7-16(8-6-15)28(25,26)23-18-9-13(2)27-22-18/h3-10H,11H2,1-2H3,(H,21,24)(H,22,23)

Standard InChI Key:  JDFJXRQXDXETKA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
    9.1277   -4.6539    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.5383   -5.3604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9449   -4.6516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5817   -5.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8715   -6.2957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1627   -5.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4572   -6.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7457   -5.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7465   -5.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4561   -4.6557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1609   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2912   -6.2936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9991   -5.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7017   -6.2956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4127   -5.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4127   -5.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7017   -4.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9991   -5.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1246   -3.8307    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8079   -2.5358    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9914   -2.6216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8266   -3.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5360   -3.8275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1403   -3.2808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9430   -3.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5809   -5.0664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0384   -6.2958    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.0389   -4.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  3  2  0
  4  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
  6 11  2  0
  5  6  1  0
 12  4  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
  1 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 20 24  1  0
 24 25  1  0
 19 22  1  0
 16  1  1  0
  4 26  2  0
  8 27  1  0
  9 28  1  0
M  END

Associated Targets(non-human)

pfk 6-phospho-1-fructokinase, putative (79 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
pfk 6-phospho-1-fructokinase (7870 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 403.44Molecular Weight (Monoisotopic): 403.1002AlogP: 3.41#Rotatable Bonds: 6
Polar Surface Area: 101.30Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 5.88CX Basic pKa: 0.38CX LogP: 3.35CX LogD: 2.49
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.66Np Likeness Score: -2.47

References

1. Brimacombe KR, Walsh MJ, Liu L, Vásquez-Valdivieso MG, Morgan HP, McNae I, Fothergill-Gilmore LA, Michels PA, Auld DS, Simeonov A, Walkinshaw MD, Shen M, Boxer MB..  (2014)  Identification of ML251, a Potent Inhibitor of T. brucei and T. cruzi Phosphofructokinase.,  (1): [PMID:24900769] [10.1021/ml400259d]
2. Miana GE, Ribone SR, Vera DMA, Sánchez-Moreno M, Mazzieri MR, Quevedo MA..  (2019)  Design, synthesis and molecular docking studies of novel N-arylsulfonyl-benzimidazoles with anti Trypanosoma cruzi activity.,  165  [PMID:30641409] [10.1016/j.ejmech.2019.01.013]

Source