2-(3,4-dichlorophenyl)-N-(4-(N-(1,3-dimethyl-1H-pyrazol-5-yl)sulfamoyl)phenyl)acetamide

ID: ALA3108860

PubChem CID: 53255401

Max Phase: Preclinical

Molecular Formula: C19H18Cl2N4O3S

Molecular Weight: 453.35

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Cc3ccc(Cl)c(Cl)c3)cc2)n(C)n1

Standard InChI:  InChI=1S/C19H18Cl2N4O3S/c1-12-9-18(25(2)23-12)24-29(27,28)15-6-4-14(5-7-15)22-19(26)11-13-3-8-16(20)17(21)10-13/h3-10,24H,11H2,1-2H3,(H,22,26)

Standard InChI Key:  GVWNZKYTGBSOKP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   11.4517   -3.0674    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6352   -3.1532    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4705   -3.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1798   -4.3592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7842   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0534   -3.9564    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.4607   -3.2479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6435   -3.2494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7972   -5.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5074   -5.1861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2170   -5.5961    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9248   -5.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6275   -5.5981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3384   -5.1918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3384   -4.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6275   -3.9646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9248   -4.3709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5066   -4.3689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0886   -5.1912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0922   -4.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3844   -3.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6767   -4.3795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6811   -5.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3895   -5.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9769   -5.6130    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.9707   -3.9729    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.7619   -4.3637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5838   -3.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0867   -2.5475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  1  5  2  0
  7  6  2  0
  6  8  2  0
 10  9  1  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 12 17  2  0
 15  6  1  0
 10 18  2  0
  9 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 23 25  1  0
 22 26  1  0
  6 27  1  0
 27  3  1  0
  5 28  1  0
  2 29  1  0
M  END

Associated Targets(non-human)

pfk 6-phospho-1-fructokinase, putative (79 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
pfk 6-phospho-1-fructokinase (7870 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 453.35Molecular Weight (Monoisotopic): 452.0477AlogP: 4.02#Rotatable Bonds: 6
Polar Surface Area: 93.09Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.67CX Basic pKa: 3.60CX LogP: 3.39CX LogD: 2.79
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.59Np Likeness Score: -2.28

References

1. Brimacombe KR, Walsh MJ, Liu L, Vásquez-Valdivieso MG, Morgan HP, McNae I, Fothergill-Gilmore LA, Michels PA, Auld DS, Simeonov A, Walkinshaw MD, Shen M, Boxer MB..  (2014)  Identification of ML251, a Potent Inhibitor of T. brucei and T. cruzi Phosphofructokinase.,  (1): [PMID:24900769] [10.1021/ml400259d]
2. Miana GE, Ribone SR, Vera DMA, Sánchez-Moreno M, Mazzieri MR, Quevedo MA..  (2019)  Design, synthesis and molecular docking studies of novel N-arylsulfonyl-benzimidazoles with anti Trypanosoma cruzi activity.,  165  [PMID:30641409] [10.1016/j.ejmech.2019.01.013]

Source