The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-methoxyphenyl)-2-{2-[5-(4-methoxyphenyl)-3-phenyl-4,5-dihydropyrazol-1-yl]-4-oxo-4,5-dihydrothiazol-5-yl}-acetamide ID: ALA3109148
PubChem CID: 43842496
Max Phase: Preclinical
Molecular Formula: C28H26N4O4S
Molecular Weight: 514.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC(=O)CC2SC(N3N=C(c4ccccc4)CC3c3ccc(OC)cc3)=NC2=O)cc1
Standard InChI: InChI=1S/C28H26N4O4S/c1-35-21-12-8-19(9-13-21)24-16-23(18-6-4-3-5-7-18)31-32(24)28-30-27(34)25(37-28)17-26(33)29-20-10-14-22(36-2)15-11-20/h3-15,24-25H,16-17H2,1-2H3,(H,29,33)
Standard InChI Key: ZPYSEVNGMSQNMO-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
15.4098 -14.4637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6284 -14.7142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0162 -15.0074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6188 -13.6722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2235 -14.3372 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.8149 -13.6322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3628 -13.0216 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1101 -13.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0219 -14.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8150 -12.9474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0004 -13.5440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4567 -14.1546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7094 -13.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7934 -13.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5918 -12.8391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0003 -14.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0003 -15.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2912 -15.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5863 -15.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5863 -14.2288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2912 -13.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9262 -12.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4461 -11.4285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7763 -10.6854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5909 -10.5972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0710 -11.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7407 -12.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9253 -9.8499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4410 -9.1908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4062 -13.4632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6193 -12.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4108 -12.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9892 -13.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7760 -13.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9845 -14.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7766 -12.8278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3549 -13.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
5 9 1 0
8 10 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
11 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
13 16 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
28 29 1 0
25 28 1 0
15 22 1 0
6 11 1 0
2 9 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
36 37 1 0
33 36 1 0
4 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.61Molecular Weight (Monoisotopic): 514.1675AlogP: 4.88#Rotatable Bonds: 7Polar Surface Area: 92.59Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.65CX Basic pKa: 1.75CX LogP: 4.26CX LogD: 2.26Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.48Np Likeness Score: -1.41