4-(2-hydroxy-3-methoxybenzylamino)-N-(4-(piperazin-1-yl)phenyl)benzenesulfonamide

ID: ALA3113184

PubChem CID: 70701364

Max Phase: Preclinical

Molecular Formula: C24H28N4O4S

Molecular Weight: 468.58

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(CNc2ccc(S(=O)(=O)Nc3ccc(N4CCNCC4)cc3)cc2)c1O

Standard InChI:  InChI=1S/C24H28N4O4S/c1-32-23-4-2-3-18(24(23)29)17-26-19-7-11-22(12-8-19)33(30,31)27-20-5-9-21(10-6-20)28-15-13-25-14-16-28/h2-12,25-27,29H,13-17H2,1H3

Standard InChI Key:  YFJVIPWBEBHHAX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    6.0445   -9.1284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2263   -9.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8197   -9.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2266  -10.5423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0448  -10.5422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4560   -9.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4482   -8.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4426   -7.0013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0359   -7.7099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2573   -7.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1870   -6.7016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4299   -2.0412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4821   -6.2907    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.7237   -4.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8965   -5.5815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7184   -5.5846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3769   -2.7424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1373   -3.4510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3823   -1.3246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6081   -2.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1319   -4.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9591   -3.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4773   -7.1086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4883   -4.8669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1987   -2.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8477   -1.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6028   -3.4603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.2040   -1.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9645   -2.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9019   -4.1553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6649   -6.2918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6704   -7.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2672   -8.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
 10  8  2  0
  9  7  2  0
 32 10  1  0
  8  9  1  0
  7 33  1  0
 15 13  1  0
 15 24  2  0
 17 25  1  0
 23 13  2  0
 28 19  2  0
 25 20  2  0
 16 21  2  0
 20 12  1  0
 22 17  1  0
 14 18  1  0
 14 30  2  0
 18 22  1  0
 21 14  1  0
 15 16  1  0
 13 11  2  0
 12 26  1  0
 19 29  1  0
 30 24  1  0
 20 28  1  0
 25 27  1  0
 17 29  2  0
 13 31  1  0
 31 10  1  0
 32 33  2  0
  7  1  1  0
M  END

Associated Targets(Human)

ALOX12 Tchem Arachidonate 12-lipoxygenase (3262 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.58Molecular Weight (Monoisotopic): 468.1831AlogP: 3.22#Rotatable Bonds: 8
Polar Surface Area: 102.93Molecular Species: BASEHBA: 7HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.15CX Basic pKa: 8.61CX LogP: 2.21CX LogD: 1.28
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.20

References

1. Luci DK, Jameson JB, Yasgar A, Diaz G, Joshi N, Kantz A, Markham K, Perry S, Kuhn N, Yeung J, Kerns EH, Schultz L, Holinstat M, Nadler JL, Taylor-Fishwick DA, Jadhav A, Simeonov A, Holman TR, Maloney DJ..  (2014)  Synthesis and structure-activity relationship studies of 4-((2-hydroxy-3-methoxybenzyl)amino)benzenesulfonamide derivatives as potent and selective inhibitors of 12-lipoxygenase.,  57  (2): [PMID:24393039] [10.1021/jm4016476]

Source