The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-hydroxy-3-methoxybenzylamino)-N-(4-(piperazin-1-yl)phenyl)benzenesulfonamide ID: ALA3113184
PubChem CID: 70701364
Max Phase: Preclinical
Molecular Formula: C24H28N4O4S
Molecular Weight: 468.58
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(CNc2ccc(S(=O)(=O)Nc3ccc(N4CCNCC4)cc3)cc2)c1O
Standard InChI: InChI=1S/C24H28N4O4S/c1-32-23-4-2-3-18(24(23)29)17-26-19-7-11-22(12-8-19)33(30,31)27-20-5-9-21(10-6-20)28-15-13-25-14-16-28/h2-12,25-27,29H,13-17H2,1H3
Standard InChI Key: YFJVIPWBEBHHAX-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
6.0445 -9.1284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2263 -9.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8197 -9.8333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2266 -10.5423 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0448 -10.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4560 -9.8330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4482 -8.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4426 -7.0013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0359 -7.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2573 -7.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1870 -6.7016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4299 -2.0412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4821 -6.2907 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.7237 -4.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8965 -5.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7184 -5.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3769 -2.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1373 -3.4510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3823 -1.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6081 -2.0381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1319 -4.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9591 -3.4541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4773 -7.1086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4883 -4.8669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1987 -2.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8477 -1.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6028 -3.4603 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2040 -1.3277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9645 -2.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9019 -4.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6649 -6.2918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6704 -7.6995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2672 -8.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
10 8 2 0
9 7 2 0
32 10 1 0
8 9 1 0
7 33 1 0
15 13 1 0
15 24 2 0
17 25 1 0
23 13 2 0
28 19 2 0
25 20 2 0
16 21 2 0
20 12 1 0
22 17 1 0
14 18 1 0
14 30 2 0
18 22 1 0
21 14 1 0
15 16 1 0
13 11 2 0
12 26 1 0
19 29 1 0
30 24 1 0
20 28 1 0
25 27 1 0
17 29 2 0
13 31 1 0
31 10 1 0
32 33 2 0
7 1 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.58Molecular Weight (Monoisotopic): 468.1831AlogP: 3.22#Rotatable Bonds: 8Polar Surface Area: 102.93Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.15CX Basic pKa: 8.61CX LogP: 2.21CX LogD: 1.28Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.20
References 1. Luci DK, Jameson JB, Yasgar A, Diaz G, Joshi N, Kantz A, Markham K, Perry S, Kuhn N, Yeung J, Kerns EH, Schultz L, Holinstat M, Nadler JL, Taylor-Fishwick DA, Jadhav A, Simeonov A, Holman TR, Maloney DJ.. (2014) Synthesis and structure-activity relationship studies of 4-((2-hydroxy-3-methoxybenzyl)amino)benzenesulfonamide derivatives as potent and selective inhibitors of 12-lipoxygenase., 57 (2): [PMID:24393039 ] [10.1021/jm4016476 ]