[11C]-N-Pyridin-[4-ylmethyl-3-[4-[2-(4-methoxyphenyl)phenyl]piperazin-1-yl]ethoxy]propanamide

ID: ALA3113606

PubChem CID: 73053494

Max Phase: Preclinical

Molecular Formula: C28H34N4O3

Molecular Weight: 474.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  [11CH3]Oc1ccc(-c2ccccc2N2CCN(CCOCCC(=O)NCc3ccncc3)CC2)cc1

Standard InChI:  InChI=1S/C28H34N4O3/c1-34-25-8-6-24(7-9-25)26-4-2-3-5-27(26)32-17-15-31(16-18-32)19-21-35-20-12-28(33)30-22-23-10-13-29-14-11-23/h2-11,13-14H,12,15-22H2,1H3,(H,30,33)/i1-1

Standard InChI Key:  IAGKNQVEHDNSKG-BJUDXGSMSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
    5.6459  -14.7376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3603  -14.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0748  -14.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7893  -14.3251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5026  -14.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2150  -14.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2192  -13.5071    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5050  -13.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7863  -13.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9314  -14.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2169  -14.7376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5025  -14.3251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7880  -14.7376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5025  -13.5001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9353  -13.0973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7880  -15.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0735  -15.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3608  -15.5573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6468  -15.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6463  -16.7951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3658  -17.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0769  -16.7933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6492  -13.5184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3647  -13.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3683  -12.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6504  -11.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9377  -12.2799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6435  -14.3435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9246  -14.7468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9186  -15.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6308  -15.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3504  -15.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3529  -14.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6262  -16.8142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9096  -17.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  9  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  1 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
  7 15  1  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 15 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 15  1  0
 23 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
 34 35  1  0
M  ISO  1  35  11
M  END

Associated Targets(non-human)

Plasma (86 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 474.61Molecular Weight (Monoisotopic): 474.2631AlogP: 3.60#Rotatable Bonds: 11
Polar Surface Area: 66.93Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.90CX LogP: 3.01CX LogD: 2.39
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -1.26

References

1. Lacivita E, Niso M, Hansen HD, Di Pilato P, Herth MM, Lehel S, Ettrup A, Montenegro L, Perrone R, Berardi F, Colabufo NA, Leopoldo M, Knudsen GM..  (2014)  Design, synthesis, radiolabeling and in vivo evaluation of potential positron emission tomography (PET) radioligands for brain imaging of the 5-HT₇ receptor.,  22  (5): [PMID:24508140] [10.1016/j.bmc.2014.01.016]

Source