The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-{3-[1-(2-Fluoro-pyridin-4-yl)-pyrrolidin-3-yloxy]-phenylamino}-4-(1H-indol-3-yl)-pyrrole-2,5-dione ID: ALA3114761
PubChem CID: 76310565
Max Phase: Preclinical
Molecular Formula: C27H22FN5O3
Molecular Weight: 483.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1Nc1cccc(O[C@H]2CCN(c3ccnc(F)c3)C2)c1
Standard InChI: InChI=1S/C27H22FN5O3/c28-23-13-17(8-10-29-23)33-11-9-19(15-33)36-18-5-3-4-16(12-18)31-25-24(26(34)32-27(25)35)21-14-30-22-7-2-1-6-20(21)22/h1-8,10,12-14,19,30H,9,11,15H2,(H2,31,32,34,35)/t19-/m0/s1
Standard InChI Key: ULLVSXLCIMTNQM-IBGZPJMESA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
18.5818 -20.7688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8509 -19.9902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6630 -19.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9344 -19.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3948 -18.4324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5803 -18.5904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3127 -19.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7451 -18.9036 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.7948 -21.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7795 -21.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5580 -22.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0544 -21.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0673 -22.2506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2545 -23.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2633 -24.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9832 -24.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9615 -22.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6822 -23.2296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6924 -24.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4861 -24.3082 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9665 -23.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4696 -22.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7105 -22.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4922 -21.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4820 -21.0861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6939 -20.8408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2172 -21.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3919 -21.5246 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1437 -20.5928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.2124 -22.3069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9182 -21.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6388 -22.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3442 -21.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3270 -21.0268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5986 -20.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8963 -21.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
1 2 1 0
4 8 1 0
1 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 1 1 0
10 13 1 6
14 15 2 0
15 16 1 0
16 19 2 0
18 17 2 0
17 14 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 18 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 1 0
27 23 1 0
22 23 1 0
27 28 2 0
25 29 2 0
24 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
33 13 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.50Molecular Weight (Monoisotopic): 483.1707AlogP: 3.84#Rotatable Bonds: 6Polar Surface Area: 99.35Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.57CX Basic pKa: 2.72CX LogP: 3.07CX LogD: 3.06Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -0.72
References 1. McDonnell ME, Bian H, Wrobel J, Smith GR, Liang S, Ma H, Reitz AB.. (2014) Anilino-monoindolylmaleimides as potent and selective JAK3 inhibitors., 24 (4): [PMID:24461299 ] [10.1016/j.bmcl.2014.01.001 ]