(S)-4-oxo-3-(2-phenylacetamido)-4-((S)-3-(4-(3-o-tolylureido)benzylcarbamoyl)pyrrolidin-1-yl)butanoic acid

ID: ALA3115407

PubChem CID: 76332375

Max Phase: Preclinical

Molecular Formula: C32H35N5O6

Molecular Weight: 585.66

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  Cc1ccccc1NC(=O)Nc1ccc(CNC(=O)[C@H]2CCN(C(=O)[C@H](CC(=O)O)NC(=O)Cc3ccccc3)C2)cc1

Standard InChI:  InChI=1S/C32H35N5O6/c1-21-7-5-6-10-26(21)36-32(43)34-25-13-11-23(12-14-25)19-33-30(41)24-15-16-37(20-24)31(42)27(18-29(39)40)35-28(38)17-22-8-3-2-4-9-22/h2-14,24,27H,15-20H2,1H3,(H,33,41)(H,35,38)(H,39,40)(H2,34,36,43)/t24-,27-/m0/s1

Standard InChI Key:  HAQDQKGZJSHMBY-IGKIAQTJSA-N

Molfile:  

     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
    4.7009  -16.8749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9497  -17.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9497  -18.0842    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2563  -16.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5093  -17.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7871  -16.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0406  -17.2396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0184  -18.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7489  -18.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4924  -18.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9063  -16.1527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2129  -15.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5815  -16.1527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5815  -16.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2129  -17.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9063  -16.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2129  -18.1049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8881  -17.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.1369  -16.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4477  -17.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7007  -16.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0155  -17.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2644  -16.8956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2644  -16.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0155  -15.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7007  -16.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5751  -15.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8281  -16.0330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1306  -15.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1306  -14.8237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4414  -16.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8099  -15.5707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1206  -16.0330    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3736  -15.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3518  -16.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2144  -16.8378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1369  -16.0330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3513  -14.8116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6773  -16.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9587  -15.6672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9364  -14.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2178  -14.4613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6326  -14.4225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 15 17  1  0
 14 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 31 29  1  1
 32 31  1  0
 33 32  1  0
 33 34  1  0
 33 35  1  0
 36 35  1  0
 31 36  1  0
 19 37  2  0
 34 38  2  0
 34 39  1  0
 39 40  1  0
 39  1  1  1
 40 41  1  0
 41 42  1  0
 41 43  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA3115407

   (3S)-4-[(3S)-3-[[4-[(2-methylphenyl)carbamoylamino]phenyl]methylcarbamoyl]pyrrolidin-1-yl]-4-oxo-3-[(2-phenylacetyl)amino]butanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 585.66

Molecular Weight (Monoisotopic): 585.2587

AlogP: 3.31

#Rotatable Bonds: 11

Polar Surface Area: 156.94

Molecular Species: ACID

HBA: 5

HBD: 5

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 5

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 4.15

CX Basic pKa: ┄

CX LogP: 2.66

CX LogD: -0.41

Aromatic Rings: 3

Heavy Atoms: 43

QED Weighted: 0.23

Np Likeness Score: -1.47

References

1. Dattoli SD, De Marco R, Baiula M, Spampinato S, Greco A, Tolomelli A, Gentilucci L..  (2014)  Synthesis and assay of retro-α4β1 integrin-targeting motifs.,  73  [PMID:24412498] [10.1016/j.ejmech.2013.12.009]

Source

Source(1):

• Scientific Literature