The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-(1-(2-(pyrimidin-2-ylthio)acetyl)-5-(2-(trifluoromethyl)phenyl)-4,5-dihydro-1H-pyrazol-3-yl)-2Hchromen-2-one ID: ALA3115513
PubChem CID: 76328704
Max Phase: Preclinical
Molecular Formula: C25H17F3N4O3S
Molecular Weight: 510.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1ncccn1)N1N=C(c2cc3ccccc3oc2=O)C[C@@H]1c1ccccc1C(F)(F)F
Standard InChI: InChI=1S/C25H17F3N4O3S/c26-25(27,28)18-8-3-2-7-16(18)20-13-19(17-12-15-6-1-4-9-21(15)35-23(17)34)31-32(20)22(33)14-36-24-29-10-5-11-30-24/h1-12,20H,13-14H2/t20-/m1/s1
Standard InChI Key: OVSRZCXYJCIYIQ-HXUWFJFHSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
44.5874 -5.3534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9999 -6.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5874 -6.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7624 -6.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3499 -7.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5249 -7.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1124 -6.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5249 -6.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3499 -6.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7624 -5.3534 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.9999 -4.6389 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.0944 -6.4804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.3098 -6.7353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.8249 -6.0679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.3098 -5.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.0944 -5.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.7619 -5.1705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.6756 -4.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.3431 -3.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.0967 -4.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.1830 -5.0211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.5155 -5.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.9219 -4.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.1739 -4.3556 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.1683 -3.6789 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
46.9039 -3.2607 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
47.7619 -6.9653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.6756 -7.7858 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
48.5155 -6.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.1830 -7.1147 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
49.9366 -6.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
50.0229 -5.9586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
50.7766 -5.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.4440 -6.1080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.3578 -6.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
50.6041 -7.2640 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
9 10 1 0
1 10 1 0
1 11 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
12 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
23 24 1 0
23 25 1 0
23 26 1 0
18 23 1 0
16 17 1 6
27 28 2 0
27 29 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
31 36 2 0
30 31 1 0
29 30 1 0
12 27 1 0
2 14 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.50Molecular Weight (Monoisotopic): 510.0973AlogP: 5.07#Rotatable Bonds: 5Polar Surface Area: 88.66Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.69CX LogP: 4.69CX LogD: 4.69Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.21Np Likeness Score: -1.33
References 1. Wu XQ, Huang C, Jia YM, Song BA, Li J, Liu XH.. (2014) Novel coumarin-dihydropyrazole thio-ethanone derivatives: design, synthesis and anticancer activity., 74 [PMID:24119869 ] [10.1016/j.ejmech.2013.06.014 ]