The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-(1-(2-(butylthio)acetyl)-5-(4-(trifluoromethyl)phenyl)-4,5-dihydro-1H-pyrazol-3-yl)-2H-chromen-2-one ID: ALA3115514
PubChem CID: 76310630
Max Phase: Preclinical
Molecular Formula: C25H23F3N2O3S
Molecular Weight: 488.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCSCC(=O)N1N=C(c2cc3ccccc3oc2=O)C[C@@H]1c1ccc(C(F)(F)F)cc1
Standard InChI: InChI=1S/C25H23F3N2O3S/c1-2-3-12-34-15-23(31)30-21(16-8-10-18(11-9-16)25(26,27)28)14-20(29-30)19-13-17-6-4-5-7-22(17)33-24(19)32/h4-11,13,21H,2-3,12,14-15H2,1H3/t21-/m1/s1
Standard InChI Key: IFOSUKRGFQIQPG-OAQYLSRUSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
45.1572 -4.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1572 -5.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4427 -5.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7283 -5.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0138 -5.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2993 -5.1722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2993 -4.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0138 -3.9347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7283 -4.3472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4427 -3.9347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.8717 -3.9347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.7649 -6.5767 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.9579 -6.4052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.8717 -5.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6253 -5.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.1774 -5.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.9979 -5.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.3334 -5.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.1539 -4.9361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.6388 -5.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.3033 -6.3572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.4828 -6.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
50.4593 -5.5173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.2798 -5.4311 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
51.0759 -6.2789 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
50.7266 -4.7558 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
47.1004 -7.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6155 -7.9978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.9209 -7.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.2565 -8.1703 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
47.7715 -8.8377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.1071 -9.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.6222 -10.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.9577 -11.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
9 10 1 0
1 10 1 0
1 11 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
12 16 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
23 24 1 0
23 25 1 0
23 26 1 0
20 23 1 0
16 17 1 6
27 28 2 0
27 29 1 0
31 32 1 0
32 33 1 0
33 34 1 0
30 31 1 0
29 30 1 0
12 27 1 0
2 14 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.53Molecular Weight (Monoisotopic): 488.1381AlogP: 6.02#Rotatable Bonds: 7Polar Surface Area: 62.88Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.78CX LogD: 5.78Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -1.20
References 1. Wu XQ, Huang C, Jia YM, Song BA, Li J, Liu XH.. (2014) Novel coumarin-dihydropyrazole thio-ethanone derivatives: design, synthesis and anticancer activity., 74 [PMID:24119869 ] [10.1016/j.ejmech.2013.06.014 ]