The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
13,21-dehydroeurycomanone ID: ALA3120500
Cas Number: 129587-06-0
PubChem CID: 13936707
Product Number: D650202, Order Now?
Max Phase: Preclinical
Molecular Formula: C20H26O9
Molecular Weight: 410.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=CC(=O)[C@@H](O)[C@]2(C)[C@H]3[C@@]4(O)OC[C@@]35[C@@H](C[C@@H]12)OC(=O)[C@H](O)[C@@]5(O)[C@@H](C)[C@H]4O
Standard InChI: InChI=1S/C20H26O9/c1-7-4-10(21)13(23)17(3)9(7)5-11-18-6-28-20(27,16(17)18)12(22)8(2)19(18,26)14(24)15(25)29-11/h4,8-9,11-14,16,22-24,26-27H,5-6H2,1-3H3/t8-,9-,11+,12+,13+,14-,16+,17+,18+,19-,20-/m0/s1
Standard InChI Key: PKICXNXDFYYYGH-QWRBDCSPSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
9.0469 -13.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0469 -14.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7590 -14.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7590 -13.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4712 -13.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4722 -14.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1832 -14.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1811 -13.0734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6198 -12.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9044 -11.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1820 -12.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3312 -13.0786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7590 -12.2472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1763 -13.8975 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.2639 -12.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4694 -11.8312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4638 -12.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7587 -15.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3372 -11.8485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6127 -13.0840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8973 -13.4871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8889 -14.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5941 -14.7232 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3093 -14.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3195 -13.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0377 -13.0912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0193 -14.7407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8806 -15.1268 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.4680 -15.1352 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.9100 -11.0122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9015 -12.3056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6057 -13.9059 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 22 1 0
8 21 1 0
8 11 1 0
20 9 1 0
9 10 1 0
10 11 1 0
1 12 2 0
4 13 1 1
8 14 1 6
21 15 1 1
11 16 1 1
5 17 1 1
3 18 1 0
9 19 1 6
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 1
24 27 2 0
22 28 1 1
6 29 1 6
10 30 1 6
11 31 1 0
31 15 1 0
20 32 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 410.42Molecular Weight (Monoisotopic): 410.1577AlogP: -1.75#Rotatable Bonds: ┄Polar Surface Area: 153.75Molecular Species: NEUTRALHBA: 9HBD: 5#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.80CX Basic pKa: ┄CX LogP: -1.66CX LogD: -1.66Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.29Np Likeness Score: 3.95
References 1. Tran TV, Malainer C, Schwaiger S, Atanasov AG, Heiss EH, Dirsch VM, Stuppner H.. (2014) NF-κB inhibitors from Eurycoma longifolia., 77 (3): [PMID:24467387 ] [10.1021/np400701k ]