(2S)-cyclo-Pentyl2-((((2R,3R,4R,5R)-5-(4-Aminopyrrolo[1,2-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyltetrahydrofuran-2-yl)methoxy)(phenoxy)phosphorylamino)-propanoate

ID: ALA3120787

PubChem CID: 58059533

Max Phase: Preclinical

Molecular Formula: C27H33N6O8P

Molecular Weight: 600.57

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@H](NP(=O)(OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@](C)(O)[C@@H]1O)Oc1ccccc1)C(=O)OC1CCCC1

Standard InChI:  InChI=1S/C27H33N6O8P/c1-17(25(35)39-18-8-6-7-9-18)32-42(37,41-19-10-4-3-5-11-19)38-14-21-23(34)26(2,36)27(15-28,40-21)22-13-12-20-24(29)30-16-31-33(20)22/h3-5,10-13,16-18,21,23,34,36H,6-9,14H2,1-2H3,(H,32,37)(H2,29,30,31)/t17-,21+,23+,26+,27-,42?/m0/s1

Standard InChI Key:  AEVVVSRGWZCNOJ-YNVDLFDSSA-N

Molfile:  

     RDKit          2D

 42 46  0  0  0  0  0  0  0  0999 V2000
    4.9711  -24.4619    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    5.3796  -23.7542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5624  -23.7542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7632  -26.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6710  -27.3551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4203  -27.0289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9461  -26.5422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0193  -25.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3547  -25.2834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6959  -25.7655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9186  -25.5134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2435  -24.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4649  -27.2027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1941  -23.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7381  -24.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9800  -23.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0087  -24.6913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7287  -25.0728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4205  -24.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3877  -23.8201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6673  -23.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6350  -22.6258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6905  -26.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3615  -26.6895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7484  -24.7141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3640  -25.0090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5867  -24.7568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9797  -25.3039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4165  -23.9576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2024  -25.0517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1499  -26.1032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9710  -23.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3840  -22.3402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9760  -21.6330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1579  -21.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7496  -22.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1599  -23.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5953  -25.5988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7935  -25.4307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3852  -26.1386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9323  -26.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6786  -26.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  2  0
  5  4  1  0
  4  6  1  1
  7  4  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
 10  7  1  0
 10 11  1  1
  8 12  1  1
  7 13  1  6
 12 17  1  0
 16 14  2  0
 14 15  1  0
 15 12  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 21 22  1  0
 23 24  3  0
  8 23  1  0
 11 25  1  0
 25  1  1  0
  1 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  6
 28 30  1  0
 28 31  2  0
  2 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 30 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 38  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3120787

   cyclopentyl (2S)-2-[[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 600.57

Molecular Weight (Monoisotopic): 600.2097

AlogP: 2.21

#Rotatable Bonds: 10

Polar Surface Area: 203.55

Molecular Species: NEUTRAL

HBA: 13

HBD: 4

#RO5 Violations: 2

HBA (Lipinski): 14

HBD (Lipinski): 5

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 10.23

CX Basic pKa: 0.65

CX LogP: 1.51

CX LogD: 1.51

Aromatic Rings: 3

Heavy Atoms: 42

QED Weighted: 0.19

Np Likeness Score: 0.14

References

1. Cho A, Zhang L, Xu J, Lee R, Butler T, Metobo S, Aktoudianakis V, Lew W, Ye H, Clarke M, Doerffler E, Byun D, Wang T, Babusis D, Carey AC, German P, Sauer D, Zhong W, Rossi S, Fenaux M, McHutchison JG, Perry J, Feng J, Ray AS, Kim CU..  (2014)  Discovery of the first C-nucleoside HCV polymerase inhibitor (GS-6620) with demonstrated antiviral response in HCV infected patients.,  57  (5): [PMID:23547794] [10.1021/jm400201a]

Source

Source(1):

• Scientific Literature