The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[1',1'':1,4'-terphenyl]-2',3',5'-triol 2'-O-beta-glucuronide ID: ALA3120853
PubChem CID: 24123416
Max Phase: Preclinical
Molecular Formula: C24H22O9
Molecular Weight: 454.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)[C@H]1O[C@@H](Oc2c(-c3ccccc3)cc(O)c(-c3ccccc3)c2O)[C@H](O)[C@@H](O)[C@@H]1O
Standard InChI: InChI=1S/C24H22O9/c25-15-11-14(12-7-3-1-4-8-12)21(17(26)16(15)13-9-5-2-6-10-13)32-24-20(29)18(27)19(28)22(33-24)23(30)31/h1-11,18-20,22,24-29H,(H,30,31)/t18-,19-,20+,22-,24+/m0/s1
Standard InChI Key: QQDLPJHEFJKVHT-MJRVOHGCSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
21.5547 -4.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7276 -4.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3345 -5.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7674 -5.7188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5975 -5.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9868 -4.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8114 -4.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5098 -5.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2440 -5.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0677 -5.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4591 -4.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0206 -4.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1982 -4.2177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0833 -4.3327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2594 -4.3547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8657 -5.0806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3019 -5.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1244 -5.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2962 -3.5849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9472 -3.5410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0320 -6.3943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6896 -2.8597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5183 -2.8425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9116 -2.1214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4838 -1.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6581 -1.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2602 -2.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4355 -2.1821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2290 -0.7311 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8798 -0.6920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7364 -2.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1651 -2.8074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.1324 -1.3789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
3 8 1 0
7 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 7 1 0
8 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 8 1 0
2 19 1 0
1 20 1 0
5 21 1 0
22 19 1 1
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 6
26 29 1 1
25 30 1 6
24 31 1 1
31 32 2 0
31 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.43Molecular Weight (Monoisotopic): 454.1264AlogP: 1.70#Rotatable Bonds: 5Polar Surface Area: 156.91Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.33CX Basic pKa: ┄CX LogP: 2.41CX LogD: -1.02Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: 1.41
References 1. Deng J, Lu C, Li S, Hao H, Li Z, Zhu J, Li Y, Shen Y.. (2014) p-Terphenyl O-β-glucuronides, DNA topoisomerase inhibitors from Streptomyces sp. LZ35ΔgdmAI., 24 (5): [PMID:24507923 ] [10.1016/j.bmcl.2014.01.037 ]