2,2,7,7-Tetramethyl-9-(1-methyl-1H-indol-2-yl)-3,4,6,7-tetrahydroacridine-1,8-(2H,5H,9H,10H)-dione

ID: ALA3121549

PubChem CID: 76314441

Max Phase: Preclinical

Molecular Formula: C26H30N2O2

Molecular Weight: 402.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1c(C2C3=C(CCC(C)(C)C3=O)NC3=C2C(=O)C(C)(C)CC3)cc2ccccc21

Standard InChI:  InChI=1S/C26H30N2O2/c1-25(2)12-10-16-20(23(25)29)22(19-14-15-8-6-7-9-18(15)28(19)5)21-17(27-16)11-13-26(3,4)24(21)30/h6-9,14,22,27H,10-13H2,1-5H3

Standard InChI Key:  PHHBRCUQSPVIJI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    8.4668   -3.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0523   -3.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6418   -3.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7465   -3.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5714   -3.9910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1618   -3.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0235   -5.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4668   -4.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1789   -5.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1789   -3.5585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8909   -3.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8874   -4.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5962   -5.2134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6032   -3.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3165   -3.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3127   -4.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0311   -3.5683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0338   -2.7434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1789   -2.7334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6056   -2.7383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2756   -2.2591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9407   -2.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1977   -1.4714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0264   -1.4739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4411   -0.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0283   -0.0430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1964   -0.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7855   -0.7577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0711   -2.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7456   -4.8145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  1  8  1  0
  1 10  1  0
  8  9  1  0
  9 12  1  0
 11 10  1  0
 11 12  2  0
 11 14  1  0
 12 13  1  0
 13 16  1  0
 15 14  1  0
 15 16  2  0
 15 17  1  0
 16  7  1  0
  7 30  1  0
  4 17  1  0
 17 18  2  0
 10 19  2  0
 14 20  1  0
 20 21  1  0
 21 24  1  0
 23 22  1  0
 22 20  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 21 29  1  0
 30  4  1  0
M  END

Associated Targets(non-human)

Stomach (183 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2307AlogP: 5.15#Rotatable Bonds: 1
Polar Surface Area: 51.10Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.77CX LogD: 4.77
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.72Np Likeness Score: -0.01

References

1. Gündüz MG, Işli F, El-Khouly A, Yıldırım S, Öztürk Fincan GS, Şimşek R, Şafak C, Sarıoğlu Y, Öztürk Yıldırım S, Butcher RJ..  (2014)  Microwave-assisted synthesis and myorelaxant activity of 9-indolyl-1,8-acridinedione derivatives.,  75  [PMID:24534541] [10.1016/j.ejmech.2014.01.059]

Source