3,3,6,6-Tetramethyl-9-(1-methyl-1H-indol-2-yl)-3,4,6,7-tetrahydroacridine-1,8-(2H,5H,9H,10H)-dione

ID: ALA3121550

PubChem CID: 4606769

Max Phase: Preclinical

Molecular Formula: C26H30N2O2

Molecular Weight: 402.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1c(C2C3=C(CC(C)(C)CC3=O)NC3=C2C(=O)CC(C)(C)C3)cc2ccccc21

Standard InChI:  InChI=1S/C26H30N2O2/c1-25(2)11-16-22(20(29)13-25)24(19-10-15-8-6-7-9-18(15)28(19)5)23-17(27-16)12-26(3,4)14-21(23)30/h6-10,24,27H,11-14H2,1-5H3

Standard InChI Key:  TXVPPTPQPLJSHB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   20.5160   -5.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9250   -5.9057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3409   -5.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2373   -5.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4123   -5.1761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8258   -5.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2373   -4.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5168   -4.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7938   -5.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9493   -5.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9493   -3.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6614   -4.3499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6578   -5.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3666   -5.5881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3736   -3.9382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0870   -4.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0831   -5.1835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8015   -3.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8041   -3.1183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9493   -3.1083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3759   -3.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0459   -2.6340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7112   -2.6303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9682   -1.8464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7968   -1.8489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2115   -1.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7987   -0.4180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9669   -0.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5559   -1.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8415   -2.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  7  4  1  0
  7 11  1  0
  4 10  1  0
 10 13  1  0
 12 11  1  0
 12 13  2  0
 12 15  1  0
 13 14  1  0
 14 17  1  0
 16 15  1  0
 16 17  2  0
 16 18  1  0
 17  9  1  0
  9  1  1  0
  8 18  1  0
 18 19  2  0
 11 20  2  0
 15 21  1  0
 21 22  1  0
 22 25  1  0
 24 23  1  0
 23 21  2  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 22 30  1  0
  1  8  1  0
M  END

Associated Targets(non-human)

Stomach (183 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2307AlogP: 5.15#Rotatable Bonds: 1
Polar Surface Area: 51.10Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.74CX LogD: 3.74
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.72Np Likeness Score: -0.48

References

1. Gündüz MG, Işli F, El-Khouly A, Yıldırım S, Öztürk Fincan GS, Şimşek R, Şafak C, Sarıoğlu Y, Öztürk Yıldırım S, Butcher RJ..  (2014)  Microwave-assisted synthesis and myorelaxant activity of 9-indolyl-1,8-acridinedione derivatives.,  75  [PMID:24534541] [10.1016/j.ejmech.2014.01.059]

Source