2,2,7,7-Tetramethyl-9-(1-methyl-1H-indol-3-yl)-3,4,6,7-tetrahydroacridine-1,8-(2H,5H,9H,10H)-dione

ID: ALA3121552

PubChem CID: 76328907

Max Phase: Preclinical

Molecular Formula: C26H30N2O2

Molecular Weight: 402.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cc(C2C3=C(CCC(C)(C)C3=O)NC3=C2C(=O)C(C)(C)CC3)c2ccccc21

Standard InChI:  InChI=1S/C26H30N2O2/c1-25(2)12-10-17-21(23(25)29)20(16-14-28(5)19-9-7-6-8-15(16)19)22-18(27-17)11-13-26(3,4)24(22)30/h6-9,14,20,27H,10-13H2,1-5H3

Standard InChI Key:  BYTTZIGBPFAFCC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    9.2920  -10.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8775   -9.5621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4670  -10.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5718  -10.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3968  -10.2912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9871   -9.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8488  -11.5238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2920  -11.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0041  -11.5088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0041   -9.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7162  -10.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7126  -11.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4215  -11.5137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4285   -9.8637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1418  -10.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1380  -11.1090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8564   -9.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8591   -9.0437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0041   -9.0337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4308   -9.0386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1007   -8.5595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8517   -7.7742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5709  -11.1149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7660   -8.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0224   -7.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4742   -7.1631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6694   -7.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4158   -8.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9657   -8.7261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3391   -7.1085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  0
  5  4  1  0
  4  6  1  0
  1  8  1  0
  1 10  1  0
  8  9  1  0
  9 12  1  0
 11 10  1  0
 11 12  2  0
 11 14  1  0
 12 13  1  0
 13 16  1  0
 15 14  1  0
 15 16  2  0
 15 17  1  0
 16  7  1  0
  7 23  1  0
  4 17  1  0
 17 18  2  0
 10 19  2  0
 14 20  1  0
 20 21  2  0
 21 22  1  0
 24 20  1  0
 25 22  1  0
 23  4  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 22 30  1  0
M  END

Associated Targets(non-human)

Stomach (183 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2307AlogP: 5.15#Rotatable Bonds: 1
Polar Surface Area: 51.10Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.93CX LogD: 4.93
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.72Np Likeness Score: -0.04

References

1. Gündüz MG, Işli F, El-Khouly A, Yıldırım S, Öztürk Fincan GS, Şimşek R, Şafak C, Sarıoğlu Y, Öztürk Yıldırım S, Butcher RJ..  (2014)  Microwave-assisted synthesis and myorelaxant activity of 9-indolyl-1,8-acridinedione derivatives.,  75  [PMID:24534541] [10.1016/j.ejmech.2014.01.059]

Source