5,7-Di-O-benzoyl chrysin

ID: ALA3121616

Cas Number: 110865-06-0

PubChem CID: 11005062

Max Phase: Preclinical

Molecular Formula: C29H18O6

Molecular Weight: 462.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Oc1cc(OC(=O)c2ccccc2)c2c(=O)cc(-c3ccccc3)oc2c1)c1ccccc1

Standard InChI:  InChI=1S/C29H18O6/c30-23-18-24(19-10-4-1-5-11-19)34-25-16-22(33-28(31)20-12-6-2-7-13-20)17-26(27(23)25)35-29(32)21-14-8-3-9-15-21/h1-18H

Standard InChI Key:  XGEYPCLLAKGAQQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   25.4914  -11.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2081  -12.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9289  -11.8541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9289  -11.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4830  -11.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2038  -10.6041    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7706  -12.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7706  -10.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0581  -11.8624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0581  -11.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2081  -13.0999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6413  -10.6124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7706  -13.0999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3456  -10.6166    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3539  -11.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6331   -9.7916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0663  -10.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3455   -9.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0663   -9.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6307  -11.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9166  -10.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9206   -9.7913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2075   -9.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4915   -9.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4933  -10.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2070  -11.0285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0561  -13.5124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0561  -14.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3383  -14.7461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3378  -15.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0529  -15.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7697  -15.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7666  -14.7438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6297  -11.8532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3417  -13.0999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  6  1  0
  5  1  1  0
  6  5  1  0
  7  1  2  0
  8  5  2  0
  9  7  1  0
 10  9  2  0
 11  2  2  0
 12  4  1  0
 13  7  1  0
 14 10  1  0
 15 12  2  0
 16 12  1  0
 17 15  1  0
 18 16  2  0
 19 18  1  0
  8 10  1  0
  3  4  2  0
 17 19  2  0
 14 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 13 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 20 34  2  0
 27 35  2  0
M  END

Alternative Forms

Associated Targets(non-human)

H22 (575 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.46Molecular Weight (Monoisotopic): 462.1103AlogP: 5.90#Rotatable Bonds: 5
Polar Surface Area: 82.81Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.29CX LogD: 6.29
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: 0.28

References

1. Zhu ZY, Wang WX, Wang ZQ, Chen LJ, Zhang JY, Liu XC, Wu SP, Zhang YM..  (2014)  Synthesis and antitumor activity evaluation of chrysin derivatives.,  75  [PMID:24556144] [10.1016/j.ejmech.2013.12.044]

Source