The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,7-Di-O-benzoyl chrysin ID: ALA3121616
Cas Number: 110865-06-0
PubChem CID: 11005062
Max Phase: Preclinical
Molecular Formula: C29H18O6
Molecular Weight: 462.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Oc1cc(OC(=O)c2ccccc2)c2c(=O)cc(-c3ccccc3)oc2c1)c1ccccc1
Standard InChI: InChI=1S/C29H18O6/c30-23-18-24(19-10-4-1-5-11-19)34-25-16-22(33-28(31)20-12-6-2-7-13-20)17-26(27(23)25)35-29(32)21-14-8-3-9-15-21/h1-18H
Standard InChI Key: XGEYPCLLAKGAQQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
25.4914 -11.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2081 -12.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9289 -11.8541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9289 -11.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4830 -11.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2038 -10.6041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7706 -12.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7706 -10.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0581 -11.8624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0581 -11.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2081 -13.0999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6413 -10.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7706 -13.0999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3456 -10.6166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3539 -11.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6331 -9.7916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0663 -10.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3455 -9.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0663 -9.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6307 -11.0282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9166 -10.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9206 -9.7913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2075 -9.3780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4915 -9.7897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4933 -10.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2070 -11.0285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0561 -13.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0561 -14.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3383 -14.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3378 -15.5703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0529 -15.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7697 -15.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7666 -14.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6297 -11.8532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3417 -13.0999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 6 1 0
5 1 1 0
6 5 1 0
7 1 2 0
8 5 2 0
9 7 1 0
10 9 2 0
11 2 2 0
12 4 1 0
13 7 1 0
14 10 1 0
15 12 2 0
16 12 1 0
17 15 1 0
18 16 2 0
19 18 1 0
8 10 1 0
3 4 2 0
17 19 2 0
14 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
13 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
20 34 2 0
27 35 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 462.46Molecular Weight (Monoisotopic): 462.1103AlogP: 5.90#Rotatable Bonds: 5Polar Surface Area: 82.81Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.29CX LogD: 6.29Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: 0.28
References 1. Zhu ZY, Wang WX, Wang ZQ, Chen LJ, Zhang JY, Liu XC, Wu SP, Zhang YM.. (2014) Synthesis and antitumor activity evaluation of chrysin derivatives., 75 [PMID:24556144 ] [10.1016/j.ejmech.2013.12.044 ]