5-O-(Ethoxycarbonyl)methyl-7-O-benzoyl chrysin

ID: ALA3121617

PubChem CID: 76325363

Max Phase: Preclinical

Molecular Formula: C26H20O7

Molecular Weight: 444.44

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)COc1cc(OC(=O)c2ccccc2)cc2oc(-c3ccccc3)cc(=O)c12

Standard InChI:  InChI=1S/C26H20O7/c1-2-30-24(28)16-31-22-13-19(32-26(29)18-11-7-4-8-12-18)14-23-25(22)20(27)15-21(33-23)17-9-5-3-6-10-17/h3-15H,2,16H2,1H3

Standard InChI Key:  QLOMWTQNQXXFTK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    5.4666  -18.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1833  -18.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9041  -18.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9041  -17.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4583  -17.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1791  -16.7540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7458  -18.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7458  -16.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0333  -18.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0333  -17.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1833  -19.2498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6166  -16.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7458  -19.2498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3208  -16.7665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3290  -17.1748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6082  -15.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0416  -16.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3208  -15.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0416  -15.9290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0313  -19.6623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0313  -20.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7458  -20.8998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3169  -20.8998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024  -20.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8879  -20.8998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6058  -17.1781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8919  -16.7648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8958  -15.9411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1828  -15.5279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4668  -15.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4684  -16.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1822  -17.1784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6048  -18.0031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  6  1  0
  5  1  1  0
  6  5  1  0
  7  1  2  0
  8  5  2  0
  9  7  1  0
 10  9  2  0
 11  2  2  0
 12  4  1  0
 13  7  1  0
 14 10  1  0
 15 12  2  0
 16 12  1  0
 17 15  1  0
 18 16  2  0
 19 18  1  0
  8 10  1  0
  3  4  2  0
 17 19  2  0
 13 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 14 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 26 33  2  0
M  END

Associated Targets(non-human)

H22 (575 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.44Molecular Weight (Monoisotopic): 444.1209AlogP: 4.62#Rotatable Bonds: 7
Polar Surface Area: 92.04Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.45CX LogD: 4.45
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: 0.05

References

1. Zhu ZY, Wang WX, Wang ZQ, Chen LJ, Zhang JY, Liu XC, Wu SP, Zhang YM..  (2014)  Synthesis and antitumor activity evaluation of chrysin derivatives.,  75  [PMID:24556144] [10.1016/j.ejmech.2013.12.044]

Source