The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cannogenol ID: ALA3122165
PubChem CID: 11872742
Max Phase: Preclinical
Molecular Formula: C23H34O5
Molecular Weight: 390.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@H]3[C@@H](CC[C@@H]4C[C@@H](O)CC[C@@]43CO)[C@@]1(O)CC[C@@H]2C1=CC(=O)OC1
Standard InChI: InChI=1S/C23H34O5/c1-21-7-5-18-19(3-2-15-11-16(25)4-8-22(15,18)13-24)23(21,27)9-6-17(21)14-10-20(26)28-12-14/h10,15-19,24-25,27H,2-9,11-13H2,1H3/t15-,16+,17-,18+,19-,21-,22-,23+/m1/s1
Standard InChI Key: CDMVQQAHEQVSMF-NNNAONFXSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
13.1229 -4.5624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7059 -7.0165 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.1268 -4.5456 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.8517 -3.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9970 -4.9539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2850 -6.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4191 -4.9550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1343 -5.3734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4289 -2.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5711 -6.6091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7017 -4.5456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8575 -4.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8494 -4.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7024 -2.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6446 -3.8904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6314 -5.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9071 -3.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9970 -6.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4212 -6.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4142 -5.7790 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.6943 -2.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1357 -6.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7091 -5.3706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2850 -5.3706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7101 -6.1956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8435 -5.7873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9202 -1.7780 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1423 -3.7190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3746 -1.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4057 -4.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9904 -4.1434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28 30 1 0
7 30 1 0
23 11 1 1
1 15 1 0
13 26 1 1
16 1 1 0
13 16 1 0
14 29 2 0
25 2 1 1
12 28 1 0
23 5 1 0
14 27 1 0
21 14 1 0
12 4 1 1
24 5 1 0
17 21 2 0
27 9 1 0
7 20 1 6
22 8 1 0
19 22 1 0
7 8 1 0
6 18 1 0
12 13 1 0
25 19 1 0
8 3 1 1
8 13 1 0
9 17 1 0
23 25 1 0
23 7 1 0
15 17 1 1
15 12 1 0
24 6 1 0
18 25 1 0
6 10 1 1
11 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.52Molecular Weight (Monoisotopic): 390.2406AlogP: 2.58#Rotatable Bonds: 2Polar Surface Area: 86.99Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.88CX Basic pKa: 0.28CX LogP: 1.79CX LogD: 1.79Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.63Np Likeness Score: 3.36
References 1. Shi LS, Kuo SC, Sun HD, Morris-Natschke SL, Lee KH, Wu TS.. (2014) Cytotoxic cardiac glycosides and coumarins from Antiaris toxicaria., 22 (6): [PMID:24582402 ] [10.1016/j.bmc.2014.01.052 ]